4-Nitrophenyl b-D-ribofuranoside
4-Nitrophenyl beta-D-ribofuranoside is a synthetic chromogenic molecule designed to profile phosphorolytic enzyme activity, specifically ribonucleoside-hydrolyzing enzymes. Upon hydrolysis by these enzymes, it releases a 4-nitrophenolic compound, which can be monitored spectrophotometrically at 405-410 nm as a quantitative indicator of enzyme activity. This substrate is suitable for studying ribonucleoside-hydrolyzing enzymes, such as ribo- and deoxyribonucleases, in various biological systems and, in turn, could help advance our understanding of nucleic acid metabolism, gene function, and regulatory processes.
CAS Number |
59495-69-1; 6892-58-6 |
Product Name |
p-Nitrophenyl beta-d-ribofuranoside |
IUPAC Name |
(2R,3S,4R,5S)-2-(hydroxymethyl)-5-(4-nitrophenoxy)oxolane-3,4-diol |
Molecular Formula |
C11H13NO7 |
Molecular Weight |
271.225 |
InChI |
InChI=1S/C11H13NO7/c13-5-8-9(14)10(15)11(19-8)18-7-3-1-6(2-4-7)12(16)17/h1-4,8-11,13-15H,5H2/t8-,9-,10-,11-/m1/s1 |
InChI Key |
DUYYBTBDYZXISX-GWOFURMSSA-N |
SMILES |
C1=CC(=CC=C1[N+](=O)[O-])OC2C(C(C(O2)CO)O)O |