Phenolphthaleinglucuronide
$100.10 – $200.10
Catalog No: A10GD-4412
Cas No: 6820-54-8
Properties: Mol Formula: C26H21NaO10, Mol Weight: 516.4
IUPAC Name: sodium;(3R,4R,5S)-3,4,5-trihydroxy-6-[4-[1-(4-hydroxyphenyl)-3-oxo-2-benzofuran-1-yl]phenoxy]oxane-2-carboxylate
Synonym: EINECS 229-896-3, Phenolphthalein b-D-glucuronide sodium salt, phenolphthalein glucuronide sodium
PHEG,Phenolphthalein b-D-glucuronide sodium salt monohydrate
Phenolphthalein glucuronide sodium is a chemical compound that has gained significant attention in recent years due to its potential implications in various fields of scientific research and industry. In this paper, we will explore the definition and background of this compound, its physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity, and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations, and future directions.
Definition and Background:
Phenolphthalein glucuronide sodium is a synthetic compound that is used to enhance the solubility of phenolphthalein. This compound is a glucuronide conjugate of phenolphthalein, which makes it water-soluble and easily measurable. Phenolphthalein is a pH indicator that changes color in the presence of an acid or base. By conjugating phenolphthalein with glucuronide, its properties are changed, and it can be used in various scientific applications.
Physical and Chemical Properties:
Phenolphthalein glucuronide sodium is a white powder that is soluble in water. It has a molecular weight of 432.36 g/mol and a melting point of 300?C. It is often used in the form of a sodium salt, which has a chemical formula of C20H14NaO10.
Synthesis and Characterization:
Phenolphthalein glucuronide sodium can be synthesized through the conjugation of phenolphthalein with glucuronic acid. This conjugation process is often carried out using glucuronidation enzymes. Once the conjugation process is complete, the compound can be characterized through methods such as nuclear magnetic resonance (NMR) spectroscopy, liquid chromatography-mass spectrometry (LC-MS), high-performance liquid chromatography (HPLC), and infrared (IR) spectroscopy.
Analytical Methods:
Phenolphthalein glucuronide sodium can be measured using various analytical methods, including LC-MS, HPLC, and UV-Vis spectroscopy. These methods are used to determine the concentration and purity of the compound.
Biological Properties:
Phenolphthalein glucuronide sodium has been shown to have anticancer properties. Studies have found that this compound can inhibit the growth and proliferation of cancer cells. It has also been shown to have anti-inflammatory properties and has the potential to be used in the treatment of inflammatory diseases.
Toxicity and Safety in Scientific Experiments:
Phenolphthalein glucuronide sodium has been shown to be safe in scientific experiments. Studies have found that it does not have any significant toxicity or side effects.
Applications in Scientific Experiments:
Phenolphthalein glucuronide sodium is used in various scientific applications, including drug discovery, pharmacokinetics, and toxicology testing. It is used to enhance the solubility of phenolphthalein, making it more easily measurable in various scientific assays.
Current State of Research:
Phenolphthalein glucuronide sodium is an active area of research. Scientists are currently investigating its potential applications in various fields of research, including cancer research, drug discovery, and toxicology testing.
Potential Implications in Various Fields of Research and Industry:
Phenolphthalein glucuronide sodium has the potential to be used in various fields of research and industry. It can be used in cancer research to develop new treatments and therapies. It can also be used in drug discovery to enhance the solubility of various compounds. Additionally, it can be used in toxicology testing to measure the toxicity of various substances.
Limitations and Future Directions:
One limitation of phenolphthalein glucuronide sodium is its stability. The compound is prone to hydrolysis, which can make it difficult to store and use in various scientific applications. Future research should focus on developing more stable conjugates of phenolphthalein that can be used in various scientific applications. Additionally, future research should investigate the potential of this compound in various fields, including cancer research, drug discovery, and toxicology testing.
Future Directions:
1. Develop more stable conjugates of phenolphthalein to enhance its use in various scientific applications.
2. Investigate the potential of phenolphthalein glucuronide sodium in other fields of research such as neurodegenerative diseases, cardiovascular diseases, and infectious diseases.
3. Research the potential of phenolphthalein glucuronide sodium in the development of novel drug delivery systems.
4. Investigate the potential of phenolphthalein glucuronide sodium in personalized medicine.
5. Explore the potential of phenolphthalein glucuronide sodium in the treatment of rare diseases.
6. Conduct more in-depth studies to fully understand the biological properties and mechanisms of action of phenolphthalein glucuronide sodium.
7. Develop more advanced analytical methods that can accurately measure the concentration and purity of phenolphthalein glucuronide sodium.
8. Explore the potential of phenolphthalein glucuronide sodium in the development of new diagnostics and biomarkers.
| CAS Number | 6820-54-8 |
| Product Name | Phenolphthalein glucuronide sodium |
| IUPAC Name | sodium;3,4,5-trihydroxy-6-[4-[1-(4-hydroxyphenyl)-3-oxo-2-benzofuran-1-yl]phenoxy]oxane-2-carboxylate |
| Molecular Formula | C26H21NaO10 |
| Molecular Weight | 516.4 g/mol |
| InChI | InChI=1S/C26H22O10.Na/c27-15-9-5-13(6-10-15)26(18-4-2-1-3-17(18)24(33)36-26)14-7-11-16(12-8-14)34-25-21(30)19(28)20(29)22(35-25)23(31)32;/h1-12,19-22,25,27-30H,(H,31,32);/q;+1/p-1 |
| InChI Key | GBLJULUMBNYFAK-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C(=O)OC2(C3=CC=C(C=C3)O)C4=CC=C(C=C4)OC5C(C(C(C(O5)C(=O)[O-])O)O)O.[Na+] |
| Canonical SMILES | C1=CC=C2C(=C1)C(=O)OC2(C3=CC=C(C=C3)O)C4=CC=C(C=C4)OC5C(C(C(C(O5)C(=O)[O-])O)O)O.[Na+] |
| Size | 1 G, 100 MG, 5 G, Other |
|---|
Related Products
IUPAC:Fuc(a1-2)[GalNAc(a1-3)]Gal(b1-3)GlcNAc(b1-3)Gal(b1-4)b-Glc, G82858KU
10 in stock
10 in stock
GalNAc-a1,3-(Fuc-a1,2)-Gal-b1,4-Glc, CAS:59957-92-5, G19524AS
10 in stock
Fuc-a1,2-Gal-b1,3-GalNAc-b1,3-Gal-a1,4-Gal-b1,4-Glc, CAS:-, G98465JN
10 in stock










