Resorufin a-D-mannopyranoside
Resorufin a-D-mannopyranoside is a fluorogenic substrate that reacts with an enzyme to produce light. It is used in the detection of glucose in urine and as a chromogenic substrate for the detection of phenylalanine, tyrosine, histidine, and tryptophan. Resorufin a-D-mannopyranoside can also be conjugated to other molecules to form fluorescent probes. It is suitable for use in diagnostics, food testing, and cell culture media.
| CAS Number | 125440-92-8 |
| Product Name | Resorufin a-d-mannopyranoside |
| IUPAC Name | 7-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenoxazin-3-one |
| Molecular Formula | C18H17NO8 |
| Molecular Weight | 375.333 |
| InChI | InChI=1S/C18H17NO8/c20-7-14-15(22)16(23)17(24)18(27-14)25-9-2-4-11-13(6-9)26-12-5-8(21)1-3-10(12)19-11/h1-6,14-18,20,22-24H,7H2/t14-,15-,16+,17+,18+/m1/s1 |
| InChI Key | QULZFZMEBOATFS-ZBRFXRBCSA-N |
| SMILES | C1=CC2=C(C=C1OC3C(C(C(C(O3)CO)O)O)O)OC4=CC(=O)C=CC4=N2 |