1,2,4,6-Tetra-O-acetyl-3-deoxy-D-glucopyranose is a compound that can inhibit the activity of the NOD1 and NOD2 receptors. It has been shown to be active against bone marrow macrophages and can be used as a potential treatment for inflammatory disorders. 1,2,4,6-Tetra-O-acetyl-3-deoxy-D-glucopyranose binds to the conformation of the NOD1 and NOD2 receptors in an uncompetitive manner. This binding prevents phosphorylation of the receptor and results in reduced NFkappaB activation.
| CAS Number | 5040-09-5 |
| Product Name | 1,2,4,6-Tetra-O-acetyl-3-deoxy-D-glucopyranose |
| IUPAC Name | [(2R,3S,5R)-3,5,6-triacetyloxyoxan-2-yl]methyl acetate |
| Molecular Formula | C14H20O9 |
| Molecular Weight | 332.305 |
| InChI | InChI=1S/C14H20O9/c1-7(15)19-6-13-11(20-8(2)16)5-12(21-9(3)17)14(23-13)22-10(4)18/h11-14H,5-6H2,1-4H3/t11-,12+,13+,14?/m0/s1 |
| InChI Key | TWQVUVQFUFLAHX-OANWKOAXSA-N |
| SMILES | CC(=O)OCC1C(CC(C(O1)OC(=O)C)OC(=O)C)OC(=O)C |
| Synonyms | 3-Deoxy-D-ribo-hexopyranose Tetraacetate; |
| CAS No: 5040-09-5 Synonyms: 3-Deoxy-1,2,4,6-tetra-O-acetyl-D-glucopyranose MDL No: MFCD03425542 Chemical Formula: C14H20O9 Molecular Weight: 332.3 |