2,3,4,6-Tetra-O-acetyl-a-D-glucopyranosyl chloride (TAOC) is a nuclear magnetic resonance (NMR) probe that has been used to study the structure of nuclei. It is synthesised by reacting acetyl chloride with sucrose in a reaction catalyzed by sodium hydroxide. The compound can be detected in quadrupole and resonance spectroscopy due to its high sensitivity to nuclear magnetic resonance. This NMR probe is typically used to study the structures of nuclei or for the analysis of polysaccharides.
Chemical Name |
2,3,4,6-TETRA-O-ACETYL-?-D-GLUCOPYRANOSYL CHLORIDE |
Synonyms |
2,3,4,6-Tetra-O-acetyl-alpha-D-glucopyranosyl chloride |
CAS No. |
4451-35-8 |
Molecular Formula |
C14H19ClO9 |
Molecular Weight |
366.74800 |
MDL No |
MFCD00190701 |
Smiles |
CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)Cl)OC(=O)C)OC(=O)C)OC(=O)C |
PSA |
114.43000 |
LogP |
0.30830 |
CAS No: 4451-35-8 MDL No: MFCD00190701 Chemical Formula: C14H19ClO9 Molecular Weight: 366.748 |