2′,7‘-Dichlorofluorescein diacetate
Fluorogenic probe used for the detection of reactive oxygen species
2′,7′-Dichlorofluorescein diacetate is as a cell-permeable fluorogenic probe to quantify reactive oxygen species (ROS) and nitric oxide (NO). It is rapidly de-esterified in cells is oxidized to form fluorescent 2′,7′-dichlorofluorescein. 2’7-Dichlorofluorescein displays excitation/emission spectra of 492/515 nm.
Diacetyldichlorofluorescein is the stable storage form of dichlorofluorescein.
| CAS Number | 2044-85-1 |
| Product Name | Diacetyldichlorofluorescein |
| IUPAC Name | (6′-acetyloxy-2′,7′-dichloro-3-oxospiro[2-benzofuran-1,9′-xanthene]-3′-yl) acetate |
| Molecular Formula | C24H14Cl2O7 |
| Molecular Weight | 485.3 g/mol |
| InChI | InChI=1S/C24H14Cl2O7/c1-11(27)30-21-9-19-15(7-17(21)25)24(14-6-4-3-5-13(14)23(29)33-24)16-8-18(26)22(31-12(2)28)10-20(16)32-19/h3-10H,1-2H3 |
| InChI Key | VQVUBYASAICPFU-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C2C(=C1)OC3=CC(=C(C=C3C24C5=CC=CC=C5C(=O)O4)Cl)OC(=O)C)Cl |
| Solubility | Soluble in DMSO |
| Synonyms | 2′,7′-dichlorofluorescein diacetate, 2′,7′-dichlorofluorescin diacetate, 2′,7′-difluorofluorescein, DCFDA, DCFH-DA, diacetyldichlorofluorescein, leuco-DCF diacetate, leukodiacetyl-2,7-dichlorofluorescein |
| Canonical SMILES | CC(=O)OC1=C(C=C2C(=C1)OC3=CC(=C(C=C3C24C5=CC=CC=C5C(=O)O4)Cl)OC(=O)C)Cl |