Methyl 2,3-O-isopropylidene-?-D-ribofuranoside is a heterocycle that is classified as a furanose. It reacts with reactive compounds such as nitro groups to form nitrofurans. This compound also has carcinogenic properties and has been shown to be an animal carcinogen. Methyl 2,3-O-isopropylidene-?-D-ribofuranoside is also capable of forming conformationally constrained derivatives in which the carbonyl group adopts an ?,?’-diaxial orientation with the adjacent nitrogen atom and can be used for synthesis of phenalenes.
CAS Number | 4099-85-8 |
Product Name | Methyl 2,3-O-isopropylidene-beta-D-ribofuranoside |
IUPAC Name | (4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl)methanol |
Molecular Formula | C9H16O5 |
Molecular Weight | 204.22 g/mol |
InChI | InChI=1S/C9H16O5/c1-9(2)13-6-5(4-10)12-8(11-3)7(6)14-9/h5-8,10H,4H2,1-3H3 |
InChI Key | DXBHDBLZPXQALN-WCTZXXKLSA-N |
SMILES | CC1(OC2C(OC(C2O1)OC)CO)C |
Synonyms | Methyl 2,3-O-(1-Methylethylidene)-?-D-ribofuranoside; NSC 85191; |
Canonical SMILES | CC1(OC2C(OC(C2O1)OC)CO)C |
Isomeric SMILES | CC1(O[C@@H]2[C@H](O[C@H]([C@@H]2O1)OC)CO)C |
CAS No: 4099-85-8 MDL No: MFCD00270040 Chemical Formula: C9H16O5 Molecular Weight: 204.22 |
References: 1. Griffon JF, Dukhan D, Pierra C, Benzaria S, Loi AG, et al., Nucleosides Nucleotides & Nucleic Acids 2003, Vol22, No5-8, p707-709 |