Copyright © 2024 Escientificsolutions LLC.
| Chemical Formula | C17H25N3O16P2 |
|
|---|---|---|
| Molecular Weight | 589.34 Daltons | |
| Monoisotopic Mass | 591.0866548559 Daltons |
| Chemical Formula | C19H28N4O16P2 |
|
|---|---|---|
| Molecular Weight | 630.4 Daltons | |
| Monoisotopic Mass | 632.1132039574 Daltons |
| Molecular Weight | 610.27 |
|---|---|
| Formula | C15H22N2Na2O17P2 |
| CAS No. | 137868-52-1 |
| Appearance | Solid |
| Color | White to off-white |
| SMILES | O=C(C=CN1[C@H]2[C@H](O)[C@H](O)[C@@H](COP(OP(O[C@@H]3[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O3)(O[Na])=O)(O[Na])=O)O2)NC1=O |
| Initial Source |
|
| Shipping | Room temperature in continental US; may vary elsewhere. |
| Name | UDP-Gal.2Na |
| Catalog No. | GN02006 |
| CAS Number | 137868-52-1;2956-16-3 |
| Formula | C15H22N2O17P2Na2 |
| M.W. | 610.27 |
10 in stock
| Name | UDP-GalA.3Na |
| Catalog No. | GN02008 |
| CAS Number | 148407-07-2 |
| Formula | C15H19N2O18P2Na3 |
| M.W. | 646.23 |
10 in stock
| Molecular Weight | 651.32 |
|---|---|
| Formula | C17H25N3Na2O17P2 |
| CAS No. | |
| Appearance | Solid |
| Color | White to off-white |
| SMILES | O[C@H]1[C@H](N2C(NC(C=C2)=O)=O)O[C@H](COP(OP(O[C@@H]3[C@@H]([C@H]([C@H](O)[C@@H](CO)O3)O)NC(C)=O)(O[Na])=O)(O[Na])=O)[C@H]1O |
| Shipping | Room temperature in continental US; may vary elsewhere. |
| Storage | -20°C, sealed storage, away from moisture |
| Name | UDP-GalNAc.2Na |
| Catalog No. | GN02010 |
| CAS Number | 108320-87-2; 7277-98-7 |
| Formula | C17H25N3O17P2Na2 |
| M.W. | 651.32 |
10 in stock
| Molecular Weight | 692.33 |
|---|---|
| Formula | C17H24N6Na2O17P2 |
| CAS No. | 653600-61-4 |
| Appearance | Solid |
| Color | White to off-white |
| SMILES | O[C@H]1[C@@H](O)[C@H](N2C(NC(C=C2)=O)=O)O[C@@H]1COP(OP(O[C@@H]3[C@H](NC(CN=[N+]=[N-])=O)[C@@H](O)[C@@H](O)[C@@H](CO)O3)(O[Na])=O)(O[Na])=O |
| Shipping | Room temperature in continental US; may vary elsewhere. |
| Storage | 4°C, sealed storage, away from moisture *In solvent : -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture) |
| Name | UDP-GalNAz.2Na |
| Catalog No. | GN02012 |
| CAS Number | 653600-61-4 |
| Formula | C17H24N6O17P2Na2 |
| M.W. | 692.05 |
| Purity | min 90% by HPLC |
10 in stock
| Molecular Weight | 610.27 |
|---|---|
| Formula | C15H22N2Na2O17P2 |
| CAS No. | 28053-08-9 |
| Appearance | Solid |
| Color | White to off-white |
| SMILES | O[C@H]1[C@@](N2C(NC(C=C2)=O)=O)([H])O[C@@H]([C@H]1O)COP(OP(O[C@H]3O[C@@H]([C@H]([C@@H]([C@H]3O)O)O)CO)(O[Na])=O)(O[Na])=O |
| Name | UDP-Glc.2Na |
| Catalog No. | GN02005 |
| CAS Number | 28053-08-9;?117756-22-6 |
| Formula | C15H22N2O17P2Na2 |
| M.W. | 610.27 |
10 in stock
We do serve all your needs in glycoscience from products, services, networking and announcements.
Copyright © 2024 Escientificsolutions LLC.
