2,4-Dinitrophenyl 2-deoxy-2-fluoro-b-D-glucopyranoside
2,4-Dinitrophenyl 2-deoxy-2-fluoro-b-D-glucopyranoside is a fluorinated derivative of 2,4-dinitrophenyl 2,3,5,6 tetrafluorobenzoyl bromide. It is an inhibitor of the enzyme complex cGMP phosphodiesterase (PDE), which is involved in the regulation of blood pressure and heart rate. This compound also has been shown to inhibit the production of inflammatory cytokines by polymorphonuclear leucocytes. Clinical relevance studies have demonstrated that 2,4-Dinitrophenyl 2-deoxy-2-fluoro-b-D-glucopyranoside may be a potential treatment for metastatic colorectal cancer.
| CAS Number | 111495-86-4 |
| Product Name | 2,4-Dinitrophenyl 2-Deoxy-2-Fluoro-Beta-D-Glucopyranoside |
| IUPAC Name | 6-(2,4-dinitrophenoxy)-5-fluoro-2-(hydroxymethyl)oxane-3,4-diol |
| Molecular Formula | C12H13FN2O9 |
| Molecular Weight | 348.24 g/mol |
| InChI | InChI=1S/C12H13FN2O9/c13-9-11(18)10(17)8(4-16)24-12(9)23-7-2-1-5(14(19)20)3-6(7)15(21)22/h1-3,8-12,16-18H,4H2 |
| InChI Key | UFSBFVZQJZMIOU-LZQZFOIKSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])OC2C(C(C(C(O2)CO)O)O)F |
| Canonical SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])OC2C(C(C(C(O2)CO)O)O)F |
| Isomeric SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)F |