4-Methylumbelliferyl b-D-xylobioside
4-Methylumbelliferyl b-D-xylobioside is a conjugate that can be used as an enzyme substrate, a chromogenic substrate, or a ligand. It has many different applications in various industries, including food testing and diagnostics. 4-Methylumbelliferyl b-D-xylobioside is a fluorogenic substrate that can be used to detect the presence of peroxidase activity in the presence of hydrogen peroxide. This product also has chemiluminescent properties, which make it useful for detecting luminescence in the presence of luciferin.
CAS Number | 158962-91-5 |
Product Name | 4-Methylumbelliferyl xylobiose |
IUPAC Name | 7-[(2S,3R,4R,5R)-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-methylchromen-2-one |
Molecular Formula | C20H24O11 |
Molecular Weight | 440.4 g/mol |
InChI | InChI=1S/C20H24O11/c1-8-4-14(22)30-12-5-9(2-3-10(8)12)29-19-18(26)16(24)13(7-28-19)31-20-17(25)15(23)11(21)6-27-20/h2-5,11,13,15-21,23-26H,6-7H2,1H3/t11-,13-,15+,16+,17-,18-,19+,20+/m1/s1 |
InChI Key | OAEJNHLLPXDPCN-WZZSYRLHSA-N |
SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OC3C(C(C(CO3)OC4C(C(C(CO4)O)O)O)O)O |
Canonical SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OC3C(C(C(CO3)OC4C(C(C(CO4)O)O)O)O)O |
Isomeric SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)O[C@H]3[C@@H]([C@H]([C@@H](CO3)O[C@H]4[C@@H]([C@H]([C@@H](CO4)O)O)O)O)O |