N-(3-Sulfopropyl)-3,3′,5,5′-tetramethylbenzidine sodium salt ;TMBZ-PS
4-Amino-4′-sulfopropylamino-3,3′,5,5′-tetramethylbiphenyl sodium salt; Sodium 3-((4′-amino-3,3′,5,5′-tetramethyl-[1,1′-biphenyl]-4-yl)amino)propane-1-sulfonate
N-(3-Sulfopropyl)-3,3′,5,5′-tetramethylbenzidine (TMB) sodium salt is a highly sensitive chromogenic substrate used for the detection and quantification of peroxidase enzyme activity. This water-soluble substrate undergoes a color change from colorless to blue upon oxidation by peroxidase enzymes in the presence of hydrogen peroxide. The reaction can be stopped by adding an acid, resulting in a yellow color that can be measured spectrophotometrically. TMB sodium salt is widely used in various applications, including enzyme-linked immunosorbent assays (ELISA), immunohistochemistry, and other diagnostic tests, due to its high sensitivity, low background signal, and excellent stability.
| CAS Number | 102062-46-4 |
| Product Name | Sodium 3-((4′-amino-3,3′,5,5′-tetramethyl-[1,1′-biphenyl]-4-yl)amino)propane-1-sulfonate |
| IUPAC Name | sodium;3-[4-(4-amino-3,5-dimethylphenyl)-2,6-dimethylanilino]propane-1-sulfonate |
| Molecular Formula | C19H25N2NaO3S |
| Molecular Weight | 384.5 g/mol |
| InChI | InChI=1S/C19H26N2O3S.Na/c1-12-8-16(9-13(2)18(12)20)17-10-14(3)19(15(4)11-17)21-6-5-7-25(22,23)24;/h8-11,21H,5-7,20H2,1-4H3,(H,22,23,24);/q;+1/p-1 |
| InChI Key | JOBKFCDDANZFOP-UHFFFAOYSA-M |
| SMILES | CC1=CC(=CC(=C1N)C)C2=CC(=C(C(=C2)C)NCCCS(=O)(=O)[O-])C.[Na+] |
| Canonical SMILES | CC1=CC(=CC(=C1N)C)C2=CC(=C(C(=C2)C)NCCCS(=O)(=O)[O-])C.[Na+] |