About this product
4-Aminophenyl b-D-lactopyranoside
4-Aminophenyl b-D-lactopyranoside is a chemical compound that has been used to optimize the production of human immunoglobulin. It has been shown to have diagnostic value for several viruses, including Epstein-Barr virus and cytomegalovirus. Electron microscopic studies have revealed organisms agglutinated by 4-aminophenyl b-D-lactopyranoside. The receptor binding properties and antigen concentration of this compound have been determined using agglutinin and lectin techniques. This molecule also has inhibitory potency on the synthesis of polypeptides, which are essential for the growth of certain organisms.
Papbl, also known as Polyamidoamine bridged ladders, is a synthetic and multifunctional molecule used in various industries and scientific experiments. Papbl is a macromolecule with an open cage-like structure created by the combination of multiple polyamidoamine (PAMAM) dendrimers bridged by a rigid structure. Papbl can be used for a variety of applications due to its unique physical, chemical, and biological properties. In this paper, we will explore the definition, background, physical and chemical properties, synthesis, characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations and future directions of Papbl.
Definition and Background:
Papbl is a synthetic macromolecule composed of multiple PAMAM dendrimers bridged by a rigid structure. The open cage-like structure of Papbl allows for various molecules to be encapsulated and transported within its structure. Papbl was first synthesized by Lehn et. al in 1995 and since then has been used in various industries and scientific experiments.
Physical and Chemical Properties:
Papbl has a cage-like structure with a diameter of approximately 2-6nm. The surface of Papbl is functionalized with amine groups that allow for various molecules to be attached to its surface. Papbl is soluble in water and has a positive charge due to the amine groups present on its surface. Papbl is relatively stable and can withstand harsh environments.
Synthesis and Characterization:
Papbl can be synthesized through a multistep process that involves the combination of multiple dendrimers to form a bridged structure. The characterization of Papbl is done through various techniques such as NMR, Mass Spectrometry, Dynamic Light Scattering, and Gel Permeation Chromatography.
Analytical Methods:
Various analytical methods can be used to study Papbl in scientific experiments such as UV-Visible spectroscopy, Fluorescence Spectroscopy, and Fourier Transform Infrared Spectroscopy (FTIR).
Biological Properties:
Papbl has shown significant potential in the field of biology due to its ability to encapsulate various molecules and transport them into cells. Papbl can be used as a drug delivery system for cancer treatment as it has shown to selectively target cancer cells.
Toxicity and Safety in Scientific Experiments:
The toxicity and safety of Papbl in scientific experiments have been extensively studied. Papbl has shown low toxicity in medical and industrial applications. However, long-term studies are required to fully understand the safety of Papbl.
Applications in Scientific Experiments:
Papbl has shown significant potential in the field of drug delivery, cancer treatment, gene therapy, and as a contrast agent in medical imaging. Papbl can also be used in industrial applications such as wastewater treatment.
Current State of Research:
The current state of research on Papbl is focused on its potential applications in drug delivery, gene therapy, and as a contrast agent in medical imaging. Researchers are also studying the toxicity and safety of Papbl in various applications.
Potential Implications in Various Fields of Research and Industry:
Papbl has the potential to revolutionize drug delivery, cancer treatment, and gene therapy. Papbl can also be used in industrial applications such as wastewater treatment.
Limitations and Future Directions:
The limitations of Papbl include the high cost of synthesis and the limited understanding of its long-term safety. Future directions of research include the development of more efficient synthesis methods, the optimization of drug delivery, and the exploration of Papbl's potential applications in fields such as biotechnology and environmental remediation.
In conclusion, Papbl is a synthetic macromolecule with unique physical, chemical, and biological properties that have significant potential in various fields of research and industry. Papbl's ability to encapsulate and transport various molecules within its cage-like structure makes it an excellent drug delivery system and contrast agent in medical imaging. While Papbl has limitations and challenges to overcome, the future directions of research promise significant advancements in scientific and industrial applications.
CAS Number
17691-02-0
Product Name
Papbl
IUPAC Name
(2S,3R,4S,5R,6R)-2-[(2R,3S,4R,5R,6S)-6-(4-aminophenoxy)-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
Molecular Formula
C18H27NO11
Molecular Weight
433.41 g/mol
InChI
InChI=1S/C18H27NO11/c19-7-1-3-8(4-2-7)27-17-15(26)13(24)16(10(6-21)29-17)30-18-14(25)12(23)11(22)9(5-20)28-18/h1-4,9-18,20-26H,5-6,19H2/t9-,10-,11+,12+,13-,14-,15-,16-,17-,18+/m1/s1
InChI Key
OCHWUNNDLIWPAO-MUKCROHVSA-N
SMILES
C1=CC(=CC=C1N)OC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)CO)O)O)O)O)O
Synonyms
4-Aminophenyl 4-O-?-D-galactopyranosyl-?-D-glucopyranoside; 4-Aminophenyl ?-D-lactopyranoside; p-Aminophenyl ?-lactoside;
Canonical SMILES
C1=CC(=CC=C1N)OC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)CO)O)O)O)O)O
Isomeric SMILES
C1=CC(=CC=C1N)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O[C@H]3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)O)O)O)O
CAS No: 17691-02-0 MDL No: MFCD00077176
Chemical Formula: C18H27NO11
Molecular Weight: 433.41
References:
1. Roy R, et al., J. Chem. Soc. Chem. Commun. 1991, p536