4-Methylumbelliferyl-b-D-xylotrioside

4-Methylumbelliferyl-b-D-xylotrioside 4-Methylumbelliferyl-b-D-xylotrioside is a fluorogenic substrate that reacts with an enzyme in the presence of oxygen to produce light. It is used in diagnostic applications, such as detecting the presence of a specific enzyme or protein. 4-Methylumbelliferyl-b-D-xylotrioside can also be used as a chromogenic substrate for the detection of DNA and RNA. This compound can be conjugated with other molecules for use in immunoassays and other diagnostic applications. 4-Methylumbelliferyl-b-D-xylotrioside has been shown to bind to bacterial cells and activate them, which leads to the production of light through bioluminescence. CAS No 250252-60-9 Molecular Weight 572.51 g/mol Molecular Formula C25H32O15 Smiles CC1=CC(=O)OC2=C1C=CC(=C2)O[C@H]3[C@@H]([C@H]([C@@H](CO3)O[C@H]4[C@@H]([C@H]([C@@H](CO4)O[C@H]5[C@@H]([C@H]([C@@H](CO5)O)O)O)O)O)O)O