5-Bromo-4-chloro-3-indolylbutyrate

5-Bromo-4-chloro-3-indolyl butyrate 5-Bromo-4-chloro-3-indoxyl butyrate is a colorimetric substrate used to detect and quantify esterase activity. Upon hydrolysis by esterases, it yields a blue-green dye, allowing the detection and quantification of enzyme activity. It is commonly used in assays for the screening of esterase-producing microorganisms and in research aimed at understanding the role of esterases in various cellular processes. CAS Number 129541-43-1 Product Name 5-Bromo-4-chloro-3-indolyl butyrate IUPAC Name (5-bromo-4-chloro-1H-indol-3-yl) butanoate Molecular Formula C12H11BrClNO2 Molecular Weight 316.58 g/mol InChI InChI=1S/C12H11BrClNO2/c1-2-3-10(16)17-9-6-15-8-5-4-7(13)12(14)11(8)9/h4-6,15H,2-3H2,1H3 InChI Key UKTKOBRRRRODGL-UHFFFAOYSA-N SMILES CCCC(=O)OC1=CNC2=C1C(=C(C=C2)Br)Cl Canonical SMILES CCCC(=O)OC1=CNC2=C1C(=C(C=C2)Br)Cl