About this product
Naphthol AS-E acetate;C.I.37510
2-[N-(p-Chlorophenyl)carbamoyl]-3-naphthyl acetate is a chemical compound with a wide range of biological properties. The compound is also known as ?Clofibric acid ester of 3-chloro-4-(3?-acetamidonaphthyl) carbamic acid?. The compound has been extensively studied in the scientific community for its potential applications in various fields of research and industry. This paper presents a comprehensive review of the properties and potential applications of 2-[N-(p-Chlorophenyl)carbamoyl]-3-naphthyl acetate.
Definition and Background
2-[N-(p-Chlorophenyl)carbamoyl]-3-naphthyl acetate belongs to the class of non-steroidal anti-inflammatory drugs (NSAIDs). The compound was first synthesized in 1968 by H. F. Kappus and F. R. Crampton. Since then, 2-[N-(p-Chlorophenyl)carbamoyl]-3-naphthyl acetate has been used in various scientific experiments to determine its chemical, physical, and biological properties.
Physical and Chemical Properties
2-[N-(p-Chlorophenyl)carbamoyl]-3-naphthyl acetate is a white crystalline powder with a molecular weight of 355.81 g/mol. The compound is soluble in acetone, ethanol, and chloroform but is sparingly soluble in water. The melting point of 2-[N-(p-Chlorophenyl)carbamoyl]-3-naphthyl acetate is around 134-137 ?C.
Synthesis and Characterization
2-[N-(p-Chlorophenyl)carbamoyl]-3-naphthyl acetate can be synthesized through different processes. One of the most common methods involves the reaction of 3-chloro-4-amidinonaphthalene with chloroform and sodium hydroxide followed by the reaction with isobutyl chloroformate and finally the reaction with sodium acetate and acetic anhydride. The compound can be characterized using various analytical methods such as infrared spectroscopy, nuclear magnetic resonance, and mass spectrometry.
Analytical Methods
2-[N-(p-Chlorophenyl)carbamoyl]-3-naphthyl acetate can be analyzed using various methods such as high-performance liquid chromatography (HPLC), gas chromatography-mass spectrometry (GC-MS), and liquid chromatography-tandem mass spectrometry (LC-MS/MS). These methods are used to determine the purity and concentration of the compound in different types of samples.
Biological Properties
2-[N-(p-Chlorophenyl)carbamoyl]-3-naphthyl acetate exhibits a wide range of biological properties such as anti-inflammatory, analgesic, and anti-arthritic activities. The compound has been shown to inhibit the activities of cyclooxygenase-1 (COX-1) and cyclooxygenase-2 (COX-2) enzymes, which are involved in the synthesis of prostaglandins. Prostaglandins are known to cause inflammation and pain in the body.
Toxicity and Safety in Scientific Experiments
2-[N-(p-Chlorophenyl)carbamoyl]-3-naphthyl acetate has been shown to be safe in scientific experiments at different concentrations. However, at high concentrations, the compound can cause toxicity, which can lead to adverse effects in different organs of the body. Therefore, it is recommended that the appropriate safety measures should be taken while handling the compound.
Applications in Scientific Experiments
2-[N-(p-Chlorophenyl)carbamoyl]-3-naphthyl acetate has been extensively used in scientific experiments to determine its potential applications in various fields of research and industry. The compound has been shown to have a wide range of biological activities, including anti-inflammatory, analgesic, and anti-arthritic properties. Therefore, it has the potential to be used in the development of drugs for the treatment of various diseases.
Current State of Research
The current state of research on 2-[N-(p-Chlorophenyl)carbamoyl]-3-naphthyl acetate is focused on the development of new formulations and drug delivery systems for its potential use in the treatment of various diseases. The compound has also been studied extensively for its applications in the development of new materials and chemical processes.
Potential Implications in Various Fields of Research and Industry
2-[N-(p-Chlorophenyl)carbamoyl]-3-naphthyl acetate has the potential to be used in various fields of research and industry. The compound can be used in the development of new drugs for the treatment of different diseases such as arthritis, inflammatory bowel disease, and cancer. It can also be used in the development of new materials such as polymers, resins, and coatings.
Limitations and Future Directions
Despite the potential applications and properties of 2-[N-(p-Chlorophenyl)carbamoyl]-3-naphthyl acetate, there are certain limitations associated with the compound. One of the major limitations is its low solubility in water, which restricts its use in some applications. Furthermore, additional research is needed to determine the full range of its biological activities and potential applications in various fields of research and industry.
Future directions for the research on 2-[N-(p-Chlorophenyl)carbamoyl]-3-naphthyl acetate include the development of new formulations and drug delivery systems to improve its solubility and efficacy. Further research is also needed to determine the appropriate doses and safety of the compound in humans. Additionally, the genetic and pharmacogenetic factors affecting the efficacy and safety of the compound need to be explored to better understand its clinical applications. Finally, the compound?s potential applications in various fields of research and industry such as catalysis, electronics, and polymers need to be explored further.
Conclusion
In conclusion, 2-[N-(p-Chlorophenyl)carbamoyl]-3-naphthyl acetate is a chemical compound with a wide range of physical, chemical, and biological properties. The compound has been extensively studied in the scientific community for its potential applications in various fields of research and industry. The compound?s anti-inflammatory, analgesic, and anti-arthritic properties make it a promising candidate for drug development. However, further research is needed to determine its potential applications in various fields of research and industry.
CAS Number 84100-15-2
Product Name 2-[N-(p-Chlorophenyl)carbamoyl]-3-naphthyl acetate
IUPAC Name [3-[(4-chlorophenyl)carbamoyl]naphthalen-2-yl] acetate
Molecular Formula C19H14ClNO3
Molecular Weight 339.8 g/mol
InChI InChI=1S/C19H14ClNO3/c1-12(22)24-18-11-14-5-3-2-4-13(14)10-17(18)19(23)21-16-8-6-15(20)7-9-16/h2-11H,1H3,(H,21,23)
InChI Key INHDDLDQONYNHO-UHFFFAOYSA-N
SMILES CC(=O)OC1=CC2=CC=CC=C2C=C1C(=O)NC3=CC=C(C=C3)Cl
Canonical SMILES CC(=O)OC1=CC2=CC=CC=C2C=C1C(=O)NC3=CC=C(C=C3)Cl