About this product
Synonyms
UDP-ManNAcA
SMILES
CC(=O)N[C@H]1([C@@H](O)[C@@H]([C@@H](C([O-])=O)O[C@@H]1OP(OP(OC[C@@H]3([C@H]([C@H]([C@H](N2(\C=C/C(=O)NC2=O))O3)O)O))(=O)[O-])(=O)[O-])O)
InChI
InChI=1S/C17H25N3O18P2/c1-5(21)18-8-10(24)11(25)13(15(27)28)36-16(8)37-40(32,33)38-39(30,31)34-4-6-9(23)12(26)14(35-6)20-3-2-7(22)19-17(20)29/h2-3,6,8-14,16,23-26H,4H2,1H3,(H,18,21)(H,27,28)(H,30,31)(H,32,33)(H,19,22,29)/p-3/t6-,8+,9-,10-,11+,12-,13+,14-,16-/m1/s1
InChIKey
InChIKey=DZOGQXKQLXAPND-XHUKORKBSA-K
UDP-ManNAcA (Uridine Diphosphate N-Acetylmannosaminuronic Acid) is a nucleotide sugar involved in the biosynthesis of glycans and polysaccharides, particularly in bacterial systems. It consists of uridine diphosphate (UDP) linked to N-acetylmannosaminuronic acid (ManNAcA), a derivative of mannose that has been modified with an acetyl group and a uronic acid group.
Structure & Properties:
Molecular Weight (MW): Approximately 619 g/mol (depending on specific form and substitutions)
Chemical Formula: C17H25N3O18P2 (approximate)
Synonyms: UDP-N-acetylmannosaminuronic acid
Functional Groups: ManNAcA contains an acetyl group at the nitrogen atom of the aminosugar and a carboxyl group (-COOH) at the 6-position, which classifies it as a uronic acid.
Biological Role:
Biosynthesis Pathway: UDP-ManNAcA is synthesized via enzymatic pathways that modify UDP-GlcNAc or UDP-GlcA precursors. These modifications introduce the uronic acid and acetyl groups that define the molecule.
Function: UDP-ManNAcA serves as a glycosyl donor in the biosynthesis of complex polysaccharides and glycoconjugates, such as bacterial capsular polysaccharides and exopolysaccharides.
Applications:
Polysaccharide Biosynthesis: UDP-ManNAcA is a key component in the biosynthesis of bacterial polysaccharides, including the capsular polysaccharides that protect bacteria from environmental stress and host immune responses.
Glycan Engineering: It is used in synthetic biology and glycobiology to create complex glycan structures for research, therapeutic development, and biotechnological applications.
Significance in Research:
Bacterial Virulence: UDP-ManNAcA is involved in the production of capsular polysaccharides that contribute to bacterial virulence and immune evasion, making it a focus of research in bacterial pathogenesis.
Synthetic Glycans: Researchers utilize UDP-ManNAcA in synthetic glycan production, which can lead to the development of novel biomaterials and therapeutic agents.
Key Roles:
Capsular Polysaccharide Synthesis: UDP-ManNAcA is a crucial building block in the biosynthesis of capsular polysaccharides, which form protective layers around certain bacteria and contribute to their survival in hostile environments.
Immune Evasion: The polysaccharides synthesized with UDP-ManNAcA play a role in helping bacteria evade detection by the host immune system, making it a target for therapeutic intervention.
Storage and Stability:
Storage: UDP-ManNAcA should be stored at -20°C in a moisture-free environment for optimal stability.
Stability: The compound is stable under these conditions but may degrade if exposed to heat, moisture, or light.
Research Applications:
Glycobiology: UDP-ManNAcA is used to study glycosylation processes in bacteria and other organisms, particularly those related to capsular polysaccharides and exopolysaccharides.
Vaccine Development: Its role in bacterial glycan biosynthesis makes it a valuable target for vaccine development, particularly for pathogens that rely on capsular polysaccharides for virulence.
Potential Impact:
Antibacterial Strategies: Targeting the enzymes involved in UDP-ManNAcA biosynthesis could disrupt the production of capsular polysaccharides, weakening bacterial defenses and making them more susceptible to the host immune response or antibacterial treatments.
Synthetic Biology: UDP-ManNAcA can be used to engineer synthetic glycans for therapeutic purposes, potentially leading to the development of new drugs or biomaterials.
Key Research Areas:
Bacterial Pathogenesis: Studying the role of UDP-ManNAcA in capsular polysaccharide biosynthesis provides insights into bacterial virulence mechanisms and the development of new antibacterial therapies.
Glycan Engineering: By manipulating the biosynthesis of UDP-ManNAcA, researchers can create novel glycan structures with potential applications in medicine, biotechnology, and materials science.
Conclusion:
UDP-ManNAcA is a key nucleotide sugar involved in the biosynthesis of bacterial polysaccharides that contribute to virulence and immune evasion. Its importance in glycan biosynthesis makes it a valuable molecule for research in bacterial pathogenesis, vaccine development, and synthetic biology. Understanding and manipulating its biosynthesis could lead to new therapeutic strategies for combating bacterial infections and advancing glycan engineering