6-Bromo-2-naphthyl b-D-galactopyranoside
6-Bromo-2-naphthyl ?-D-galactopyranoside is a chromogenic substrate commonly used for the detection of the enzymatic activity of ?-galactosidase. It can produce a yellow precipitate upon hydrolysis by ?-galactosidase, indicating the presence of the enzyme. It is often used in molecular biology applications to detect gene expression or to monitor cloning efficiency.
CAS No: 15572-30-2
Synonyms: BNGalBr-nap-b-D-gal
MDL No: MFCD00064182
Chemical Formula: C16H17BrO6
Molecular Weight: 385.21 |
| CAS Number | 15572-30-2 |
| Product Name | 6-Bromo-2-naphthyl beta-D-galactopyranoside |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-(6-bromonaphthalen-2-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Molecular Formula | C16H17BrO6 |
| Molecular Weight | 385.21 g/mol |
| InChI | InChI=1S/C16H17BrO6/c17-10-3-1-9-6-11(4-2-8(9)5-10)22-16-15(21)14(20)13(19)12(7-18)23-16/h1-6,12-16,18-21H,7H2/t12-,13+,14+,15-,16-/m1/s1 |
| InChI Key | NLRXQZJJCPRATR-LYYZXLFJSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Br)C=C1OC3C(C(C(C(O3)CO)O)O)O |
| Synonyms | 6-bromo-2-naphthyl-beta-galactopyranoside, BrNapGal |
| Canonical SMILES | C1=CC2=C(C=CC(=C2)Br)C=C1OC3C(C(C(C(O3)CO)O)O)O |
| Isomeric SMILES | C1=CC2=C(C=CC(=C2)Br)C=C1O[C@H]3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)O)O |
COA:
Product name: 6-Bromo-2-naphthyl-beta-D-galactopyranoside
M.F.: C16H17BrO6 M.W.: 385.2 CAS: 15572-30-2
Items | Standards | Results |
Appearance | White or slightly yellow crystal powder | Complies |
Identification | IR and HPLC | Complies |
NMR and MS | Should comply | Complies |
Loss weight on drying | Max.1% | 0.1% |
Heavy metal | Max. 20ppm | Complies |
Any other impurity | Max. 1% | Complies |
Total impurity | Max. 2% | Complies |
Assay | Min. 98% | 99.8% |
References:
1. Mutwakil MHAZ, Reader JP, Holdich DM, et al., Arch. Envir. Contam. Toxicol. 1997, Vol32, No2, p146-153