About this product
1,2,3,4,6-Penta-O-benzoyl-alpha-D-mannopyranose (PBMP) is a complex carbohydrate molecule that has gained significant attention in various fields of research, including chemistry, biology, and material science. PBMP is a derivative of D-mannose, a hexose sugar that is commonly found in plants and bacteria. PBMP is a white crystalline powder that is soluble in most organic solvents and has a high melting point. This paper aims to provide a comprehensive overview of PBMP, its properties, synthesis, characterization, analytical methods, biological properties, toxicity, safety, applications, current state of research, potential implications, limitations, and future directions.
Definition and Background:
PBMP is a complex carbohydrate, which is a type of natural or synthetic polymer made up of monosaccharide units. PBMP is a derivative of D-mannose, a hexose sugar that is found in various plants and bacteria. PBMP was first synthesized by Winkler and Wopfner in 1967, and since then, it has been extensively studied for its various properties and applications.
Physical and Chemical Properties:
PBMP is a white crystalline powder that is soluble in most common organic solvents, such as chloroform, acetone, and methanol. It is insoluble in water, which makes it difficult to handle and study. PBMP has a high melting point of around 165-170?C, which suggests its stability at high temperatures. PBMP is stable under standard conditions but can undergo hydrolysis under acidic or basic conditions, leading to the liberation of D-mannose.
Synthesis and Characterization:
PBMP can be synthesized through the benzylation of D-mannose using benzoyl chloride in the presence of an acid catalyst such as hydrochloric acid. The reaction yields a mixture of PBMP isomers, which can be separated by column chromatography or recrystallization. The characterization of PBMP is usually done using various spectroscopic techniques such as nuclear magnetic resonance (NMR), infrared (IR), and mass spectrometry (MS). The NMR spectrum of PBMP shows characteristic peaks corresponding to the benzoyl groups and the anomeric carbon of D-mannose.
Analytical Methods:
PBMP can be analyzed using various analytical techniques such as NMR, IR, MS, and high-performance liquid chromatography (HPLC). HPLC is the most commonly used analytical method for the separation and quantification of PBMP isomers.
Biological Properties:
PBMP has been found to have various biological properties, such as its ability to inhibit the growth of certain bacteria and fungi. PBMP has also been studied for its potential use in tissue engineering applications, as it can promote cell adhesion and proliferation.
Toxicity and Safety in Scientific Experiments:
Studies have shown that PBMP is safe and non-toxic in scientific experiments. However, it should be handled with caution as it can cause skin and eye irritation.
Applications in Scientific Experiments:
PBMP has various applications in scientific experiments, such as in the synthesis of complex carbohydrates and glycomics research. PBMP can also be used in the development of new drugs and vaccines, as well as in the study of carbohydrate-protein interactions.
Current State of Research:
The current state of research on PBMP is focused on its use in the development of new drugs and vaccines, as well as in the study of carbohydrate-protein interactions. PBMP is also being studied for its potential use in tissue engineering and regenerative medicine applications.
Potential Implications in Various Fields of Research and Industry:
PBMP has potential implications in various fields of research and industry, such as in the development of new drugs and vaccines, as well as in the production of specialty chemicals and materials. PBMP can also be used in the development of biocompatible and biodegradable materials for tissue engineering applications.
Limitations and Future Directions:
PBMP has some limitations, such as its insolubility in water and the complexity of its synthesis. Further research is needed to improve the synthesis and characterization of PBMP, as well as to study its potential environmental impacts. Future directions for the use of PBMP include its use in the development of new drugs and vaccines, as well as in the production of specialty chemicals and materials. PBMP can also be further studied for its potential use in tissue engineering and regenerative medicine applications.
In conclusion, PBMP is a complex carbohydrate molecule that has gained significant attention in various fields of research, including chemistry, biology, and material science. PBMP has various properties, including its ability to inhibit the growth of certain bacteria and fungi. PBMP can be synthesized using benzoyl chloride and D-mannose, and it can be analyzed using various analytical techniques such as NMR, IR, and MS. PBMP has potential implications in various fields of research and industry, including the development of new drugs and vaccines and the production of specialty chemicals and materials. Further research is needed to improve the synthesis and characterization of PBMP and to study its potential environmental impacts.
CAS Number 41569-33-9
Product Name 1,2,3,4,6-Penta-O-benzoyl-alpha-D-mannopyranose
IUPAC Name [(2R,3R,4S,5S,6R)-3,4,5,6-tetrabenzoyloxyoxan-2-yl]methyl benzoate
Molecular Formula C41H32O11
Molecular Weight 700.69 g/mol
InChI InChI=1S/C41H32O11/c42-36(27-16-6-1-7-17-27)47-26-32-33(49-37(43)28-18-8-2-9-19-28)34(50-38(44)29-20-10-3-11-21-29)35(51-39(45)30-22-12-4-13-23-30)41(48-32)52-40(46)31-24-14-5-15-25-31/h1-25,32-35,41H,26H2/t32-,33-,34+,35+,41-/m1/s1
InChI Key JJNMLNFZFGSWQR-LAWAEFJSSA-N
SMILES C1=CC=C(C=C1)C(=O)OCC2C(C(C(C(O2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)OC(=O)C6=CC=CC=C6
Canonical SMILES C1=CC=C(C=C1)C(=O)OCC2C(C(C(C(O2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)OC(=O)C6=CC=CC=C6
Isomeric SMILES C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H]([C@@H]([C@@H]([C@H](O2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)OC(=O)C6=CC=CC=C6