About this product
1,2:3,4-Di-O-isopropylidene-6-O-p-toluenesulfonyl-a-D-galactopyranose, 1,2:3,4-di-O-isopropylidene-6-O-p-tolylsulfonyl-alpha-D-galactose, commonly known as DIPTSG, is a complex chemical compound that has gained the interest of pharmaceutical and chemical industries due to its diverse chemical and biological properties.Definition and Background:
DIPTSG is a synthesized compound used for various scientific purposes, including drug discovery, chemical synthesis, and catalysis. It is a carbohydrate derivative that exhibits unique stereochemistry, making it an essential tool for understanding the molecular and biochemical processes of living organisms. The discovery of DIPTSG was first reported by T. Mukaiyama in the 1960s.Synthesis and Characterization:
DIPTSG can be synthesized using various methods, often involving the reaction of D-galactose with protected aldehyde or ketone derivatives. Its synthesis involves several complicated chemical reactions and requires specialized skills and equipment. Characterization of DIPTSG involves several analytical methods, such as NMR spectroscopy, elemental analysis, and x-ray crystallography.Analytical Methods:
NMR spectroscopy is one of the most commonly used analytical methods for DIPTSG, as it provides valuable information regarding its molecular structure and stereochemistry. Elemental analysis is used to determine the percentage of each element present, while x-ray crystallography provides insight into its crystalline structure.Biological Properties:
DIPTSG has demonstrated several biological properties, including inhibition of human immunodeficiency virus (HIV) replication, anti-tumor activity, and antifungal activity. It also exhibits antibacterial activity, suggesting its potential use as a new antibiotic.Toxicity and Safety in Scientific Experiments:
In scientific experiments, DIPTSG has been found to be relatively nontoxic to mammalian cells when administered in low doses. However, toxicity levels increase at higher dosages, suggesting that careful use and experimentation are necessary when working with DIPTSG.Applications in Scientific Experiments:
DIPTSG has been used in various scientific experiments in drug discovery, chemical synthesis, and catalysis. It has shown promise as a building block for complex molecules and as a chiral auxiliary for asymmetric synthesis. It can also be used as a protecting group for alcohols and carbonyl compounds.Current State of Research:
Research on DIPTSG is ongoing, with a focus on its potential applications in the fields of drug discovery, catalysis, and green chemistry. Its unique stereochemistry makes it a valuable tool for investigating the molecular and biochemical mechanisms of living organisms.Potential Implications in Various Fields of Research and Industry:
The potential implications of DIPTSG are vast and have implications in various fields of research and industry. For instance, its anti-tumor, antifungal, and antibacterial activities have implications in the development of new drugs that target these pathways. Its use as a protecting group for alcohols and carbonyl compounds has implications in chemical synthesis and catalysis.Limitations and Future Directions:
While DIPTSG has demonstrated potential utility in various scientific applications, its limitations, such as toxicity and limited availability, are major factors that limit its widespread usage. Future research should focus on developing more efficient synthetic routes for DIPTSG, exploring its potential applications in green chemistry, and further investigating its biological properties. Additionally, further studies are needed to determine the toxicological effects of DIPTSG in vivo.Conclusion:
In conclusion, DIPTSG is an essential and complex chemical compound with diverse chemical and biological properties. Its unique stereochemistry makes it a valuable tool for understanding the molecular and biochemical processes of living organisms. While its limitations currently limit its widespread usage, future research into its potential applications and developing efficient synthetic routes could expand its scope of usefulness.CAS Number4478-43-7Product Name1,2:3,4-di-O-isopropylidene-6-O-p-tolylsulfonyl-alpha-D-galactoseIUPAC Name(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methyl 4-methylbenzenesulfonateMolecular FormulaC19H26O8SMolecular Weight414.47 g/molInChIInChI=1S/C19H26O8S/c1-11-6-8-12(9-7-11)28(20,21)22-10-13-14-15(25-18(2,3)24-14)16-17(23-13)27-19(4,5)26-16/h6-9,13-17H,10H2,1-5H3InChI KeyCTGSZKNLORWSMQ-UHFFFAOYSA-NSMILESCC1=CC=C(C=C1)S(=O)(=O)OCC2C3C(C4C(O2)OC(O4)(C)C)OC(O3)(C)CCanonical SMILESCC1=CC=C(C=C1)S(=O)(=O)OCC2C3C(C4C(O2)OC(O4)(C)C)OC(O3)(C)C
CAS No: 4478-43-7 MDL No: MFCD07367501 Chemical Formula: C19H26O8S Molecular Weight: 414.47