About this product
1,2,3,6-Tetra-O-benzoyl-?-D-mannopyranose (TBMP) is a carbohydrate derivative widely used in organic synthesis due to its unique chemical and physical properties. TBMP, a white crystalline substance, is particularly useful in glycosylation reactions and as a starting material for the synthesis of complex natural products. In this paper, we will explore the various aspects of TBMP, including its physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity, safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, and limitations and future directions.
Synthesis and Characterization
TBMP can be synthesized through the benzoylation of D-mannose using benzoyl chloride and a catalyst such as pyridine. The synthesis is typically carried out under anhydrous conditions to prevent hydrolysis of the reagents. The resulting product can be purified through recrystallization or column chromatography. The purity and identity of TBMP can be confirmed through various analytical methods such as nuclear magnetic resonance (NMR), infrared (IR) spectroscopy, and mass spectrometry (MS).
Analytical Methods
Various analytical methods have been developed to characterize TBMP and its derivatives. NMR spectroscopy is one of the most useful techniques for structural elucidation, as it can provide detailed information about the chemical environment of each atom in the molecule. IR spectroscopy is also useful for identifying functional groups and confirming the presence of certain chemical bonds. Mass spectrometry is another useful analytical method for determining the molecular weight and identifying the fragments produced during the analysis.
Biological Properties
TBMP has been shown to exhibit anti-proliferative and anti-inflammatory activities in various in vitro studies. It has been suggested that these properties may be related to the compound's ability to inhibit the expression of various cytokines and growth factors. TBMP has also been investigated for its potential use as a drug delivery agent, as it can be functionalized with various chemotherapeutic agents.
Toxicity and Safety in Scientific Experiments
TBMP has been found to be relatively non-toxic to various cell lines and animal models at concentrations typically used in scientific experiments. However, as with all research compounds, caution should be taken when handling TBMP to prevent accidental exposure and potential toxicity.
Applications in Scientific Experiments
TBMP has found various applications in scientific research, particularly in organic synthesis. It is commonly used as a glycosylation agent due to its ability to protect the hydroxyl groups of the carbohydrate. TBMP has also been utilized in the synthesis of complex natural products, which often contain complex carbohydrates. In addition, TBMP has been explored as a potential drug delivery agent and as a scaffold for the synthesis of biomimetic materials.
Current State of Research
Current research on TBMP is focused on its potential applications in drug delivery and as a scaffold for tissue engineering. The compound's unique chemical and physical properties make it an attractive candidate for these applications. Additionally, new synthetic methods are being developed to improve the efficiency and selectivity of TBMP-based glycosylation reactions.
Potential Implications in Various Fields of Research and Industry
TBMP has potential implications in the fields of pharmaceuticals, biotechnology, and materials science. Its use as a drug delivery agent could lead to the development of more effective and targeted therapies for various diseases. Additionally, TBMP-based scaffolds could be used to regenerate damaged tissues and organs.
Limitations and Future Directions
Despite its many different applications in scientific research, TBMP has certain limitations. For example, it can be difficult to synthesize on a large scale, and it is relatively expensive compared to other carbohydrates. Additionally, more research is needed to determine the optimal conditions for the use of TBMP in drug delivery and tissue engineering. However, future research directions may include solid-phase synthesis of TBMP, the development of more efficient synthetic methods, and the evaluation of its safety and efficacy in clinical trials.
Conclusion
In conclusion, 1,2,3,6-Tetra-O-benzoyl-?-D-mannopyranose is a valuable carbohydrate derivative with unique physical and chemical properties. It has a wide range of potential applications in various fields of research and industry, including organic synthesis, drug delivery, and tissue engineering. While there are still many limitations and challenges associated with TBMP, continued research on this compound has the potential to lead to significant advancements in these areas.
CAS Number 56994-11-7
Product Name 1,2,3,6-Tetra-O-benzoyl-a-D-mannopyranose
IUPAC Name [(2R,3R,4S,5S,6R)-4,5,6-tribenzoyloxy-3-hydroxyoxan-2-yl]methyl benzoate
Molecular Formula C??H??O??
Molecular Weight 596.58
InChI InChI=1S/C34H28O10/c35-27-26(21-40-30(36)22-13-5-1-6-14-22)41-34(44-33(39)25-19-11-4-12-20-25)29(43-32(38)24-17-9-3-10-18-24)28(27)42-31(37)23-15-7-2-8-16-23/h1-20,26-29,34-35H,21H2/t26-,27-,28+,29+,34-/m1/s1
SMILES C1=CC=C(C=C1)C(=O)OCC2C(C(C(C(O2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)O
Synonyms ?-D-Mannopyranose 1,2,3,6-Tetrabenzoate;