1, 2-O-isopropylidene-D-xylo-pentadialdo-1, 4-furanose, CAS:53167-11-6

1,2-O-isopropylidene- D-xylo-pentadialdo-1,4-furanose, 1,2-O-Isopropylidene-alpha-D-xylo-pentodialdo-1,4-furanose, also known as isopropylidene xylose (IX), is a furanose sugar compound with applications in various fields, such as food, pharmaceutical, and chemical industries. This paper aims to provide an informative and persuasive piece of work on IX, presenting its definition and background, physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations, and future directions. Definition and Background IX is a furanose sugar, a substance derived from the dehydration of aldoses sugars. It is synthesized by the isopropylidene protection of D-xylose, a naturally occurring pentose sugar found in plant cell walls and hemicelluloses. IX has a white or off-white crystalline powder form with high solubility in water and insolubility in most organic solvents. Synthesis and Characterization IX can be synthesized in two ways: through the isopropylidene protection of D-xylose using isopropylidene dibromide in basic conditions, or through hydrogenation of D-xylose to yield D-sorbitol, followed by isopropylidene protection in acidic conditions. The synthesized IX is characterized through various methods, including nuclear magnetic resonance (NMR), infrared (IR), and mass spectroscopy. Analytical Methods Several analytical methods, including high-performance liquid chromatography (HPLC) and gas chromatography (GC), have been developed to detect and quantify IX in various matrices. HPLC is considered the gold standard method for IX analysis, owing to its high sensitivity and selectivity. Biological Properties IX has shown various biological activities, such as antioxidant, anti-inflammatory, and antimicrobial effects. It has also been suggested to have potential applications in the treatment of metabolic diseases, such as diabetes and obesity. Toxicity and Safety in Scientific Experiments Studies have shown that IX has low toxicity levels and is considered safe for use in scientific experiments. However, its effects on human health are still under investigation, and caution should be taken when handling the substance. Applications in Scientific Experiments IX has shown potential applications in various scientific experiments, such as in the production of biofuels, creation of functional foods, and development of novel pharmaceutical compounds. It can also be used as a chiral building block in organic synthesis. Current State of Research IX is still under investigation for its potential applications in various fields. Several studies have been conducted to explore its biological properties, synthesis, and applications. In recent years, the focus has shifted towards the synthesis of IX using green chemistry approaches. Potential Implications in Various Fields of Research and Industry IX has potential implications in various fields, including food, pharmaceutical, and chemical industries. In the food industry, it can be used as a sweetener or as a natural preservative. In the pharmaceutical industry, it has the potential to be used as a drug delivery system or to create new drug molecules. In the chemical industry, it can be used as a building block in the synthesis of various chemicals and polymers. Limitations and Future Directions The limitations of IX include its relatively high cost of production and limited availability. Future research should focus on developing new synthesis methods that are cost-effective and environmentally friendly. Furthermore, more studies should be conducted to explore its potential applications in various fields and to determine the safety and toxicity levels of IX. Future Directions ? Developing more efficient synthesis methods for IX ? Exploring its potential applications in the food industry ? Investigating its uses as a drug delivery system in the pharmaceutical industry ? Developing new drug molecules using IX ? Studying its potential in the creation of novel chemicals and polymers ? Determining the safety and toxicity levels of IX in more detail ? Developing new analytical methods for the quantification of IX in different matrices ? Discovering its potential uses in regenerative medicine and tissue engineering ? Identifying new chiral building blocks derived from IX ? Investigating the antimicrobial properties of IX in more detail ? Understanding its interactions with other substances to optimize its applications. In conclusion, 1,2-O-Isopropylidene-alpha-D-xylo-pentodialdo-1,4-furanose (IX) is a furanose sugar with potential applications in various fields. It has shown various biological properties and can be synthesized using several methods. Future research should focus on developing more efficient and cost-effective synthesis methods, exploring its potential applications in food and pharmaceutical industries, studying its safety and toxicity levels in more detail, discovering new potential uses, and understanding its interactions with other substances to optimize its applications. CAS Number 53167-11-6 Product Name 1,2-O-ISOPROPYLIDENE-alpha-D-XYLO-PENTODIALDO-1,4-FURANOSE IUPAC Name (3aR,5S,6S,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carbaldehyde Molecular Formula C8H12O5 Molecular Weight 188.18 g/mol InChI InChI=1S/C8H12O5/c1-8(2)12-6-5(10)4(3-9)11-7(6)13-8/h3-7,10H,1-2H3/t4-,5+,6-,7-/m1/s1 InChI Key RSHCFFAQYBYYGI-XZBKPIIZSA-N SMILES CC1(OC2C(C(OC2O1)C=O)O)C Synonyms 1,2-O-(1-Methylethylidene)-?-D-xylo-pentodialdo-1,4-furanose; 1,2-O-Isopropylidene-D-xylo-pentadialdo-1,4-furanose; Furo[2,3-d]-1,3-dioxole, ?-D-Xylo-pentodialdo-1,4-furanose Deriv.; 1,2-O-(1-Methylethylidene)-?-D-xylo-pentodialdo-1,4-furanose Canonical SMILES CC1(OC2C(C(OC2O1)C=O)O)C Isomeric SMILES CC1(O[C@@H]2[C@H]([C@H](O[C@@H]2O1)C=O)O)C