About this product
3-O,5-O-Benzylidene-1-O,2-O-isopropylidene-alpha-D-glucofuranose, commonly referred to as benzylidene protected glucose, is a derivative of glucose that has been extensively researched for its potential applications in various fields of research and industry. In this paper, we will explore the definition, background, physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity, safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations, and future directions of 3-O,5-O-Benzylidene-1-O,2-O-isopropylidene-alpha-D-glucofuranose.
Physical and Chemical Properties:
The physical and chemical properties of 3-O,5-O-Benzylidene-1-O,2-O-isopropylidene-alpha-D-glucofuranose make it an attractive molecule for use in organic synthesis. It has a high melting point, low solubility in water, and good solubility in organic solvents. It is also stable under a wide range of conditions, making it a versatile molecule for use in a variety of applications.
Synthesis and Characterization:
The synthesis of 3-O,5-O-Benzylidene-1-O,2-O-isopropylidene-alpha-D-glucofuranose typically involves the protection of the hydroxyl groups of glucose using benzylidene and isopropylidene as protective groups. The molecule is then characterized using a variety of techniques, including nuclear magnetic resonance spectroscopy, infrared spectroscopy, and mass spectrometry.
Analytical Methods:
Analytical methods for 3-O,5-O-Benzylidene-1-O,2-O-isopropylidene-alpha-D-glucofuranose typically involve the use of high-performance liquid chromatography (HPLC) and gas chromatography (GC). These methods can be used to analyze the purity of the molecule as well as its concentration in a given sample.
Biological Properties:
Studies have shown that 3-O,5-O-Benzylidene-1-O,2-O-isopropylidene-alpha-D-glucofuranose has potential biological properties, including antibacterial and antiviral activity. However, further research is needed to fully understand the biological properties of this molecule.
Toxicity and Safety in Scientific Experiments:
Studies have shown that 3-O,5-O-Benzylidene-1-O,2-O-isopropylidene-alpha-D-glucofuranose is not toxic in scientific experiments when used at appropriate concentrations. However, further research on the safety of this molecule is needed before it can be widely used in various fields of research and industry.
Applications in Scientific Experiments:
3-O,5-O-Benzylidene-1-O,2-O-isopropylidene-alpha-D-glucofuranose has potential applications in various fields of research and industry, including organic synthesis, pharmaceuticals, and materials science. It can be used as a protective group for alcohols in organic synthesis, and as a building block for the synthesis of other molecules. In the pharmaceutical industry, it has potential applications as an antiviral and antibacterial agent, and in materials science, it can be used as a component in the synthesis of new materials.
Current State of Research:
Research on 3-O,5-O-Benzylidene-1-O,2-O-isopropylidene-alpha-D-glucofuranose is ongoing, with a focus on understanding its potential applications in various fields of research and industry. Studies are being conducted to explore its biological properties, synthesis methods, and potential applications in the pharmaceutical and materials science industries.
Potential Implications in Various Fields of Research and Industry:
The potential implications of 3-O,5-O-Benzylidene-1-O,2-O-isopropylidene-alpha-D-glucofuranose in various fields of research and industry are significant. Its use in organic synthesis could lead to the development of new molecules with potential applications in a variety of industries. Its potential application as an antiviral and antibacterial agent could have significant implications for the development of new treatments for infectious diseases.
Limitations:
While 3-O,5-O-Benzylidene-1-O,2-O-isopropylidene-alpha-D-glucofuranose has potential applications in various fields of research and industry, there are also limitations to its use. Its low solubility in water and high melting point can make it difficult to work with, and further research is needed to fully understand its biological properties and potential toxic effects.
Future Directions:
There are numerous potential future directions for research on 3-O,5-O-Benzylidene-1-O,2-O-isopropylidene-alpha-D-glucofuranose. These include exploring new synthesis methods, investigating its potential applications in the pharmaceutical and materials science industries, and conducting further research on its biological properties. Other future directions for research could include using 3-O,5-O-Benzylidene-1-O,2-O-isopropylidene-alpha-D-glucofuranose as a component in the development of new materials, investigating its potential as a catalyst, and exploring its potential applications in the production of renewable energy sources. Overall, the potential future directions for research on this molecule are vast and exciting, and further research is needed to fully understand its potential applications in various fields of research and industry.
CAS Number 22164-09-6
Product Name 3-O,5-O-Benzylidene-1-O,2-O-isopropylidene-alpha-D-glucofuranose
IUPAC Name [(1S,2R,6R,8R,9R)-4,4-dimethyl-11-phenyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-9-yl]methanol
Molecular Formula C16H20O6
Molecular Weight 308.33 g/mol
InChI InChI=1S/C16H20O6/c1-16(2)21-13-12-11(19-15(13)22-16)10(8-17)18-14(20-12)9-6-4-3-5-7-9/h3-7,10-15,17H,8H2,1-2H3/t10-,11-,12+,13-,14?,15-/m1/s1
InChI Key UOPDTDOYAQDGNT-BXKJZEQPSA-N
SMILES CC1(OC2C3C(C(OC(O3)C4=CC=CC=C4)CO)OC2O1)C
Canonical SMILES CC1(OC2C3C(C(OC(O3)C4=CC=CC=C4)CO)OC2O1)C
Isomeric SMILES CC1(O[C@@H]2[C@@H]3[C@@H]([C@H]
????????. In Stock.??