About this product
3-Deoxy-L-arabinose3-Deoxy-L-threo-pentose is a five-carbon sugar molecule that is found in a number of naturally occurring compounds, including deoxysugars and aminoglycoside antibiotics. This paper will provide a comprehensive overview of 3-Deoxy-L-threo-pentose, including its definition and background, physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations, and future directions.Definition and Background
3-Deoxy-L-threo-pentose is a derivative of the pentose sugar ribose, which is commonly found in RNA. It is characterized by the absence of an oxygen atom at the 3' position on the sugar ring. This sugar derivative is known for its unique properties and plays a vital role in various biological processes.Physical and Chemical Properties
3-Deoxy-L-threo-pentose is a white crystalline powder that is soluble in water but insoluble in most organic solvents. It has a melting point of 159-161?C and a specific optical rotation of -146.5?. The chemical formula of 3-Deoxy-L-threo-pentose is C5H10O4.Synthesis and Characterization
The synthesis of 3-Deoxy-L-threo-pentose involves several steps, including the condensation of glycolaldehyde with formaldehyde and reduction of the resulting product. The compound can be characterized using various analytical methods, including NMR spectroscopy and mass spectrometry.Analytical Methods
NMR spectroscopy is widely used to analyze the structure and properties of 3-Deoxy-L-threo-pentose. Other analytical methods include IR spectroscopy and X-ray crystallography.Biological Properties
3-Deoxy-L-threo-pentose is known to play a vital role in various biological processes, including the biosynthesis of antibiotics and antitumor agents. It has been reported to inhibit the growth of several bacterial strains, including gram-negative and gram-positive bacteria.Toxicity and Safety in Scientific Experiments
Studies have shown that 3-Deoxy-L-threo-pentose is relatively safe for use in scientific experiments. However, the compound should be used with caution, and adequate safety measures should be in place.Applications in Scientific Experiments
3-Deoxy-L-threo-pentose has various applications in scientific experiments, including the synthesis of aminoglycoside antibiotics and antitumor agents. It is also used as a building block for the synthesis of various other compounds.Current State of Research
Research on 3-Deoxy-L-threo-pentose is ongoing, with scientists exploring the compound's various properties and potential applications in different fields of research.Potential Implications in Various Fields of Research and Industry
The unique properties of 3-Deoxy-L-threo-pentose make it a promising component for use in the development of new drugs, antibiotics, and other compounds. It has potential applications in various fields, including the pharmaceutical industry, biotechnology, and biomedical research.Limitations and Future Directions
Despite the promising applications of 3-Deoxy-L-threo-pentose, there are limitations to its use in clinical and research settings. Further research is needed to fully understand its potential and limitations. Future directions for research include exploring the synthesis of more complex molecules and investigating the compound's potential applications in various fields.Conclusion
In conclusion, 3-Deoxy-L-threo-pentose is a fascinating molecule with unique properties and potential applications in various fields of research and industry. Further research is needed to fully understand its potential and limitations, but the compound has promising implications for the development of new drugs and other compounds.CAS Number41107-43-1Product Name3-Deoxy-L-threo-pentoseIUPAC Name(2R,4R)-2,4,5-trihydroxypentanalMolecular FormulaC5H10O4Molecular Weight134.13 g/molInChIInChI=1S/C5H10O4/c6-2-4(8)1-5(9)3-7/h2,4-5,7-9H,1,3H2/t4-,5-/m1/s1InChI KeyGKHJPQPGKIAEJO-RFZPGFLSSA-NSMILESC(C(CO)O)C(C=O)OCanonical SMILESC(C(CO)O)C(C=O)OIsomeric SMILESC([C@H](CO)O)[C@H](C=O)O