About this product
3-O-Methanesulfonyl-D-glucopyranose, 3-O-Methylsulfonyl-D-glucopyranose (3-OMG) is a carbohydrate derivative that has gained immense interest among researchers due to its unique properties. This paper aims to provide a comprehensive overview of 3-OMG, including its physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations, and future directions.Definition and Background:
3-OMG is a monosaccharide derivative that consists of a glucose molecule with a methylsulfonyl group attached at the third carbon. Its unique structure gives it distinctive properties that set it apart from other monosaccharides. The compound is found in some natural sources, such as the red seaweed Gracilaria sp. However, much of the current research on 3-OMG involves its chemical synthesis and characterization for industrial and scientific applications.Synthesis and Characterization:
3-OMG can be synthesized through several methods, including the reaction of glucose with methanesulfonyl chloride in the presence of a base, or by reacting glucose with dimethylsulfoxide in the presence of a Lewis acid catalyst. Characterization of 3-OMG can be done through various techniques, including NMR spectroscopy and X-ray crystallography.Analytical Methods:
Several methods are used to detect and quantify 3-OMG, including high-performance liquid chromatography (HPLC), gas chromatography-mass spectrometry (GC-MS), and capillary electrophoresis (CE).Biological Properties:
3-OMG has been shown to have anti-inflammatory and antioxidant activities. It has also been studied for its potential as a prebiotic, promoting the growth of beneficial gut bacteria.Toxicity and Safety in Scientific Experiments:
Studies on 3-OMG toxicity in mammals have shown no significant adverse effects on various organs. However, more research is needed to determine its safety in humans and its potential for toxicity with long-term use.Applications in Scientific Experiments:
3-OMG has been used as a substrate in enzymatic assays and as a building block for synthesizing other molecules. It has also been studied for its potential in drug delivery systems due to its solubility in water and biocompatibility.Current State of Research:
There is ongoing research on 3-OMG for its potential in various fields, including food science, medicine, and biotechnology. Studies are ongoing to determine its effectiveness as a prebiotic, as well as its potential therapeutic applications.Potential Implications in Various Fields of Research and Industry:
The solubility and stability of 3-OMG make it a promising candidate for use in drug delivery systems. Additionally, its potential as a prebiotic could lead to its use in dietary supplements or functional foods. 3-OMG may also have implications in the development of new materials, as it can be used as a building block for biodegradable polymers.Limitations:Despite its promising properties, the use of 3-OMG is still in the early stages of research in many fields. Further studies are needed to fully understand its potential as a therapeutic agent or as a building block for new materials.Future Directions:
There are several potential future directions for research on 3-OMG, including:1. Investigating the mechanisms of its anti-inflammatory and antioxidant activities2. Determining its safety and potential toxicity in long-term studies3. Studying its effectiveness as a prebiotic and its effects on the gut microbiome4. Investigating its potential as a building block for new materials, such as biodegradable polymers or hydrogels5. Exploring its potential therapeutic applications, such as in drug delivery systems for cancer treatment or other diseases.Conclusion:
3-OMG is a promising compound with unique properties that make it an attractive candidate for various applications in research and industry. Further studies are needed to fully understand its potential uses and limitations, but its solubility, stability, and biocompatibility offer promising opportunities for future research and development.CAS Number40631-95-6Product Name3-O-Methylsulfonyl-D-glucopyranoseIUPAC Name[(3R,4S,5R,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl] methanesulfonateMolecular FormulaC7H14O8SMolecular Weight258.25InChIInChI=1S/C7H14O8S/c1-16(12,13)15-6-4(9)3(2-8)14-7(11)5(6)10/h3-11H,2H2,1H3/t3-,4-,5-,6+,7?/m1/s1InChI KeySRRSBHCHONHCPP-QTSLKERKSA-NSMILESCS(=O)(=O)OC1C(C(OC(C1O)O)CO)OCanonical SMILESCS(=O)(=O)OC1C(C(OC(C1O)O)CO)OIsomeric SMILESCS(=O)(=O)O[C@H]1[C@@H]([C@H](OC([C@@H]1O)O)CO)O
CAS No: 40631-95-6 MDL No: MFCD06657649 Chemical Formula: C7H14O8S Molecular Weight: 258.25