6-Deoxy-6-fluoro-1, 2-O-isopropylidene-a-D-glucofuranose, CAS:87586-05-8

6-Deoxy-6-fluoro-1,2-O-isopropylidene-alpha-D-glucofuranose is a carbohydrate derivative that has been of great interest to researchers due to its unique properties and potential applications. In this paper, we will explore the definition, physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations, and future directions of 6-Deoxy-6-fluoro-1,2-O-isopropylidene-alpha-D-glucofuranose. Definition and Background 6-Deoxy-6-fluoro-1,2-O-isopropylidene-alpha-D-glucofuranose is a derivative of glucose with a fluoro group attached to the anomeric position and an isopropylidene group at the C-1 and C-2 positions of the furanose ring. It has been studied for its potential to interact with enzymes involved in glycosylation and other biological processes. Synthesis and Characterization The synthesis of 6-Deoxy-6-fluoro-1,2-O-isopropylidene-alpha-D-glucofuranose involves a series of chemical reactions, including the protection of the hydroxyl groups on the glucose molecule, the introduction of the fluoro and isopropylidene groups, and the removal of the protecting groups to yield the final product. The characterization of 6-Deoxy-6-fluoro-1,2-O-isopropylidene-alpha-D-glucofuranose is typically performed using various spectroscopic techniques, including nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry. Analytical Methods Several analytical methods have been developed to detect and quantify 6-Deoxy-6-fluoro-1,2-O-isopropylidene-alpha-D-glucofuranose in biological and chemical samples. These methods include high-performance liquid chromatography (HPLC), gas chromatography (GC), and capillary electrophoresis (CE). NMR spectroscopy and mass spectrometry are also commonly used to characterize and identify the compound. Biological Properties 6-Deoxy-6-fluoro-1,2-O-isopropylidene-alpha-D-glucofuranose has been shown to interact with several enzymes, including glycosyltransferases and glycosidases. It has also been studied for its potential as an inhibitor of tumor growth and as a drug delivery agent. However, more research is needed to fully understand its biological properties and potential applications. Toxicity and Safety in Scientific Experiments Studies have shown that 6-Deoxy-6-fluoro-1,2-O-isopropylidene-alpha-D-glucofuranose is relatively safe for use in scientific experiments. However, precautions should be taken to ensure proper handling and disposal of the compound to prevent potential toxicity or environmental hazards. Applications in Scientific Experiments 6-Deoxy-6-fluoro-1,2-O-isopropylidene-alpha-D-glucofuranose has several potential applications in scientific experiments, including as a tool to study enzyme kinetics and glycoprotein synthesis. It has also been studied for its potential as an anti-tumor agent and as a biomaterial for drug delivery. Current State of Research Research on 6-Deoxy-6-fluoro-1,2-O-isopropylidene-alpha-D-glucofuranose is still in the early stages, but several studies have shown promising results. More research is needed to fully understand its biological properties and potential applications. Potential Implications in Various Fields of Research and Industry 6-Deoxy-6-fluoro-1,2-O-isopropylidene-alpha-D-glucofuranose has potential implications in various fields of research and industry, including in the study of enzyme kinetics and glycoprotein synthesis, as an anti-tumor agent, and as a drug delivery biomaterial. Its unique properties make it a valuable tool for researchers in these fields. Limitations and Future Directions One limitation of 6-Deoxy-6-fluoro-1,2-O-isopropylidene-alpha-D-glucofuranose is its relatively low solubility in water, which can limit its use in certain applications. However, research is ongoing to improve its solubility and potential applications. In the future, 6-Deoxy-6-fluoro-1,2-O-isopropylidene-alpha-D-glucofuranose may also be studied in other fields, such as materials science and nanotechnology . Future directions in research on 6-Deoxy-6-fluoro-1,2-O-isopropylidene-alpha-D-glucofuranose could include: 1. Developing improved synthesis methods for the compound that are more efficient and environmentally friendly. 2. Conducting more research on the compound's interactions with enzymes involved in glycosylation and other biological processes. 3. Investigating the compound's potential as a biomaterial for drug delivery and tissue engineering. 4. Exploring the compound's potential as a molecular probe for imaging and diagnosis. 5. Studying the compound's interactions with other compounds and its potential synergistic effects in various applications. 6. Optimizing the compound's solubility and stability to improve its potential applications in industry and research. Conclusion 6-Deoxy-6-fluoro-1,2-O-isopropylidene-alpha-D-glucofuranose is a carbohydrate derivative with unique properties that make it a valuable tool for research in several fields. Its potential applications in enzyme kinetics, glycoprotein synthesis, cancer treatment, and drug delivery make it an important compound for future research and development. However, further studies are needed to fully understand its biological properties and potential uses. CAS Number 87586-05-8 Product Name 6-Deoxy-6-fluoro-1,2-O-isopropylidene-alpha-D-glucofuranose IUPAC Name (3aR,5S,6aS)-5-(2-fluoro-1-hydroxyethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol Molecular Formula C?H??FO? Molecular Weight 222.21 InChI InChI=1S/C9H15FO5/c1-9(2)14-7-5(12)6(4(11)3-10)13-8(7)15-9/h4-8,11-12H,3H2,1-2H3/t4?,5?,6-,7+,8-/m1/s1 SMILES CC1(OC2C(C(OC2O1)C(CF)O)O)C CAS No: 87586-05-8 Chemical Formula: C9H15FO5 Molecular Weight: 222.21