About this product
b-Cyclodextrin hydrate , Cyclomaltoheptaose hydratebeta-Cyclodextrin hydrate is a cyclic oligosaccharide, which is widely used in various fields of research and industry. It is biocompatible, environmentally friendly, and possesses immense potential in the pharmaceutical, food, cosmetic industries, and many other applications. In this paper, we will discuss the definition, physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity, safety, and applications of beta-Cyclodextrin hydrate.Definition and Background
beta-Cyclodextrin hydrate is a cyclic oligosaccharide made up of seven glucose units, linked together by alpha-1,4 glycosidic bonds. It forms a cone-like structure with a hydrophilic outer surface and hydrophobic inner cavity. Cyclodextrins are classified into three types, alpha, beta, and gamma, based on the number of glucose units present in the ring structure. Beta-cyclodextrin is the most commonly used type of cyclodextrin in various applications.Physical and Chemical Properties
Beta-Cyclodextrin hydrate is a white or off-white crystalline powder with a molecular weight of 1135.50 g/mol. It has a melting point of 298-300 ?C, and is soluble in water and ethanol. It forms inclusion complexes with various molecules and compounds, due to its unique structure, which enables it to trap and stabilize guest molecules.Synthesis and Characterization
Beta-Cyclodextrin hydrate is synthesized by enzymatic conversion of starch by cyclodextrin glycosyltransferase (CGTase) or by chemical modification of beta-cyclodextrin. The synthesized product is characterized by various analytical techniques such as nuclear magnetic resonance (NMR) spectroscopy, infrared (IR) spectroscopy, and X-ray diffraction (XRD) analysis.Analytical Methods
Beta-Cyclodextrin hydrate can be quantitatively analyzed by various analytical methods, such as high-performance liquid chromatography (HPLC), gas chromatography (GC), capillary electrophoresis (CE), and mass spectrometry (MS). These methods provide information on the purity, stability, and content of beta-cyclodextrin hydrate.Biological Properties
Beta-Cyclodextrin hydrate has excellent biocompatibility and biodegradability properties, making it a suitable candidate for various biomedical applications. It also possesses antioxidant, anti-inflammatory, and antibacterial properties, making it useful in wound healing, cosmetics, and food industries.Toxicity and Safety in Scientific Experiments
Various toxicology studies have shown that beta-Cyclodextrin hydrate is safe and non-toxic, with no adverse effects observed in animal models. However, prolonged use may cause slight changes in lipid metabolism and liver function. It is essential to carry out further studies to identify any potential side effects in humans.Applications in Scientific Experiments
Beta-Cyclodextrin hydrate has numerous applications in various scientific experiments, such as drug delivery, gene therapy, and protein stabilization. It forms stable inclusion complexes with various drugs and compounds, improving their solubility, stability, bioavailability, and reducing toxicity. It is also used in molecular biology experiments, as a reagent, buffer, and surfactant.Limitations and Future Directions
Although beta-Cyclodextrin hydrate has vast potential in various applications, it has certain limitations. Its high cost limits its use in large-scale industrial applications. Further studies are necessary, to identify any potential risks associated with prolonged use, and to optimize the synthesis and characterization processes, to reduce cost and improve efficiency.Future Directions
The future of beta-Cyclodextrin hydrate research is vast, and includes the following:1. Development of new synthesis methods to improve efficiency, reduce cost, and reduce the environmental impact.2. The use of beta-Cyclodextrin hydrate in various biomedical applications, such as wound healing, tissue engineering, and drug delivery.3. The use of beta-Cyclodextrin hydrate in food applications, such as encapsulation and release of flavor and aroma compounds.4. The use of beta-Cyclodextrin hydrate in the chemical industry, such as in the separation and purification of chemicals, and for the removal of toxic compounds from the environment.5. The development of new analytical methods for the quantification and detection of beta-Cyclodextrin hydrate in various applications.Conclusion
Beta-Cyclodextrin hydrate is a unique cyclic oligosaccharide, with immense potential in various fields of research and industry. Its biocompatibility, biodegradability, and unique structure make it an ideal candidate for various biomedical, food, and chemical applications. Although it has certain limitations, there is a vast scope for future research in this field, and it is likely to have a significant impact on various industries in the future.CAS Number68168-23-0Product Namebeta-Cyclodextrin hydrateIUPAC Name(1S,3R,5R,6S,8R,10R,11S,13R,15R,16S,18R,20R,21S,23R,25R,26S,28R,30R,31S,33R,35R,36R,37R,38R,39R,40R,41R,42R,43R,44R,45R,46R,47R,48R,49R)-5,10,15,20,25,30,35-heptakis(hydroxymethyl)-2,4,7,9,12,14,17,19,22,24,27,29,32,34-tetradecaoxaoctacyclo[31.2.2.23,6.28,11.213,16.218,21.223,26.228,31]nonatetracontane-36,37,38,39,40,41,42,43,44,45,46,47,48,49-tetradecol;hydrateMolecular FormulaC42H72O36Molecular Weight1153.0InChIInChI=1S/C42H70O35.H2O/c43-1-8-29-15(50)22(57)36(64-8)72-30-9(2-44)66-38(24(59)17(30)52)74-32-11(4-46)68-40(26(61)19(32)54)76-34-13(6-48)70-42(28(63)21(34)56)77-35-14(7-49)69-41(27(62)20(35)55)75-33-12(5-47)67-39(25(60)18(33)53)73-31-10(3-45)65-37(71-29)23(58)16(31)51;/h8-63H,1-7H2;1H2/t8-,9-,10-,11-,12-,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-;/m1./s1InChI KeyJNSAKCOAFBFODP-ZQOBQRRWSA-NSMILESC(C1C2C(C(C(O1)OC3C(OC(C(C3O)O)OC4C(OC(C(C4O)O)OC5C(OC(C(C5O)O)OC6C(OC(C(C6O)O)OC7C(OC(C(C7O)O)OC8C(OC(O2)C(C8O)O)CO)CO)CO)CO)CO)CO)O)O)O.OCanonical SMILESC(C1C2C(C(C(O1)OC3C(OC(C(C3O)O)OC4C(OC(C(C4O)O)OC5C(OC(C(C5O)O)OC6C(OC(C(C6O)O)OC7C(OC(C(C7O)O)OC8C(OC(O2)C(C8O)O)CO)CO)CO)CO)CO)CO)O)O)O.OIsomeric SMILESC([C@@H]1[C@@H]2[C@@H]([C@H]([C@H](O1)O[C@@H]3[C@H](O[C@@H]([C@@H]([C@H]3O)O)O[C@@H]4[C@H](O[C@@H]([C@@H]([C@H]4O)O)O[C@@H]5[C@H](O[C@@H]([C@@H]([C@H]5O)O)O[C@@H]6[C@H](O[C@@H]([C@@H]([C@H]6O)O)O[C@@H]7[C@H](O[C@@H]([C@@H]([C@H]7O)O)O[C@@H]8[C@H](O[C@H](O2)[C@@H]([C@H]8O)O)CO)CO)CO)CO)CO)CO)O)O)O.O