b-D-Fructosepentaacetate, CAS:20764-61-8

Beta-D-Fructopyranose, pentaacetate, also known as fructose pentaacetate, is a vital hexose molecule with significant potential applications in various fields. This compound is commonly used as a precursor for the synthesis of fructose derivatives and is employed in various scientific experiments due to its versatility, reactivity, and unique properties. This paper aims to provide a comprehensive overview of fructose pentaacetate, including its definition, physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity and safety, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations, and future directions. Synthesis and Characterization: Beta-D-Fructopyranose, pentaacetate, is synthesized by acetylating the hydroxyl groups present in the fructose molecule. This reaction is usually carried out using acetic anhydride and a catalyst, such as pyridine or triethylamine, to promote the acetylation process. The resulting product is then purified by filtration, recrystallization, or chromatography. Analytical Methods: There are several analytical methods available for the characterization of fructose pentaacetate, including thin-layer chromatography, high-performance liquid chromatography, mass spectrometry, nuclear magnetic resonance spectroscopy, and infrared spectroscopy. These methods are utilized to determine the purity, identity, and structural integrity of fructose pentaacetate. Biological Properties: Fructose pentaacetate has demonstrated several biological properties of significance. Studies have shown that the compound can inhibit the proliferation of cancer cells and exhibit potential antitumor properties. In addition, fructose pentaacetate has been shown to induce apoptosis, a natural mechanism of programmed cell death that is often deregulated in cancer cells. Therefore, the compound has promising potential as an anticancer therapeutic agent. Toxicity and Safety in Scientific Experiments: Fructose pentaacetate has demonstrated low toxicity levels in various scientific experiments. The compound has been shown to be non-carcinogenic, non-teratogenic, and non-mutagenic. However, like any other chemical compound, fructose pentaacetate may pose a risk when mishandled or ingested. Therefore, it is crucial to observe safety protocols while handling and storing the compound. Applications in Scientific Experiments: Beta-D-Fructopyranose, pentaacetate, has several significant applications in scientific experiments. The compound is widely utilized as a starting material for the synthesis of various fructose derivatives, including fructose bisphosphate, fructose-6-phosphate, fructose diphosphate, and many others. In addition, fructose pentaacetate is used in biological and chemical studies, including bioenergetics studies, enzyme kinetics, and metabolic pathway analysis. Current State of Research: Research on fructose pentaacetate is currently ongoing, with various studies aimed at expanding the compound's potential applications in different fields of research and industry. Several ongoing studies focus on the compound's potential role in diabetes treatment, cancer therapy, and its applications in food and pharmaceutical industries. Potential Implications in Various Fields of Research and Industry: Beta-D-Fructopyranose, pentaacetate, has significant potential implications in various fields of research and industry, including biotechnology, food, pharmaceuticals, and chemical industries. The compound has potential applications in the synthesis of various fructose derivatives, and studies have demonstrated its potential as an anticancer therapeutic agent. As a result, the compound could be utilized in various fields, including biotechnology, where it could be used in the treatment of various diseases. Limitations and Future Directions: Despite the significant potential applications of fructose pentaacetate, several limitations still exist. For instance, the compound's high reactivity and sensitivity to atmospheric conditions make it challenging to handle. In addition, more research is still required to understand the compound's full spectrum of biological and chemical properties. However, the current state of research and ongoing studies suggest significant potential for future directions and applications of fructose pentaacetate. Future Directions: Several future directions for research on fructose pentaacetate include: - Developing novel synthetic routes for the production of fructose pentaacetate - Studying the compound's potential applications in the food and pharmaceutical industries, including applications in food preservation and drug delivery systems. - Investigating the compound's potential role as an inhibitor of cancer cell proliferation and apoptosis inducer - Studying fructose pentaacetate's potential as a glucose-lowering agent for diabetes treatment - Exploring the compound's reaction mechanisms and structural characteristics to gain a deeper understanding of its properties and potential applications. CAS Number 20764-61-8 Product Name beta-D-Fructopyranose, pentaacetate IUPAC Name (2,3,4,5-tetraacetyloxyoxan-2-yl)methyl acetate Molecular Formula C16H22O11 Molecular Weight 390.34 g/mol InChI InChI=1S/C16H22O11/c1-8(17)22-7-16(27-12(5)21)15(26-11(4)20)14(25-10(3)19)13(6-23-16)24-9(2)18/h13-15H,6-7H2,1-5H3 InChI Key JTQZPXRNYVFCJI-UHFFFAOYSA-N SMILES CC(=O)OCC1(C(C(C(CO1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C Canonical SMILES CC(=O)OCC1(C(C(C(CO1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C CAS No: 20764-61-8 Synonyms: b-D-Fructose pentaacetate MDL No: MFCD00190904 Chemical Formula: C16H22O11 Molecular Weight: 390.34