About this product
Mannopyranose, pentaacetate, beta-d- is a complex organic compound that has been a topic of interest for scientists due to its numerous potential applications in various fields of research and industry. This paper aims to explore the properties, methods of synthesis, characterization, and analytical methods related to Mannopyranose, pentaacetate, beta-d-. Additionally, the paper will discuss the biological properties, toxicity, safety in scientific experiments, and applications in scientific experiments. Future directions and potential implications in various fields of research and industry will also be examined.
Definition and Background:
Mannopyranose, pentaacetate, beta-d- is a complex organic compound that belongs to a group of monosaccharides known as hexoses. It is obtained through the acetylation of D-mannose, which is a simple sugar derived from glucose. The compound is mainly used in the synthesis of glycosides, a class of compounds that are widely used in the pharmaceutical industry.
Synthesis and Characterization:
Mannopyranose, pentaacetate, beta-d- can be synthesized through the acetylation of D-mannose using acetic anhydride and catalytic amounts of sulfuric acid. The reaction is carried out at room temperature for several hours, and the product is obtained using standard methods of purification such as recrystallization or column chromatography.
The compound can be characterized using various spectroscopic techniques such as nuclear magnetic resonance (NMR) and infrared (IR) spectroscopy. NMR spectroscopy is used to determine the structural information of the compound, while IR spectroscopy is used to detect the presence of functional groups in the compound.
Analytical Methods:
Analytical methods used to detect Mannopyranose, pentaacetate, beta-d- include chromatography and mass spectrometry. High-performance liquid chromatography (HPLC) can be used to separate and quantitate the compound from a mixture of other compounds. Mass spectrometry is used to identify the molecular weight and fragmentation pattern of the compound.
Biological Properties:
Mannopyranose, pentaacetate, beta-d- has been shown to have various biological properties such as antibacterial, antifungal, and antitumor activities. The compound has been found to inhibit the growth of Gram-positive bacteria, such as Staphylococcus aureus and Bacillus subtilis.
Toxicity and Safety in Scientific Experiments:
Studies have shown that Mannopyranose, pentaacetate, beta-d- is relatively safe in experimental settings. However, the compound may be toxic if ingested or inhaled. Therefore, proper safety measures should be taken when handling the compound.
Applications in Scientific Experiments:
Mannopyranose, pentaacetate, beta-d- has various applications in scientific experiments such as in the synthesis of glycosides, which are widely used in the pharmaceutical industry. The compound can also be used as a building block to synthesize other complex carbohydrates such as oligosaccharides.
Current State of Research:
The research on Mannopyranose, pentaacetate, beta-d- is still ongoing, with new applications and potential uses being discovered. Many researchers are focused on exploring the compound's biological properties and its potential as an anticancer agent.
Potential Implications in Various Fields of Research and Industry:
Mannopyranose, pentaacetate, beta-d- has numerous potential implications in various fields of research and industry. In the pharmaceutical industry, the compound can be used as a building block for the synthesis of drugs, and in the food industry, it can be used as a sweetener. Additionally, the compound can be used in the production of biofuels due to its structural similarities to cellulose.
Limitations and Future Directions:
The synthesis of Mannopyranose, pentaacetate, beta-d- is relatively complex and requires various reagents and catalytic amounts of sulfuric acid. Additionally, the compound's hydrophobicity may limit its solubility in aqueous solutions. Future research should focus on developing more efficient and cost-effective methods of synthesis and exploring potential applications in other fields of research and industry.
Some possible future directions for research include:
1. Exploring the compound's potential as an antiviral agent
2. Developing new methods of synthesis that do not require toxic reagents or catalysts
3. Investigating the potential of the compound in the development of new biomaterials
4. Studying the compound's interactions with biological macromolecules such as proteins and DNA
5. Examining the compound's potential use in drug delivery systems.
Conclusion:
Mannopyranose, pentaacetate, beta-d- is a complex organic compound with numerous potential applications in various fields of research and industry. The compound's physical and chemical properties, methods of synthesis and characterization, analytical methods, biological properties, toxicity, safety in scientific experiments, and applications have been discussed in detail in this paper. Future directions and potential implications in various fields of research and industry have also been examined. The research on Mannopyranose, pentaacetate, beta-d- is still ongoing, and new applications and potential uses are constantly being discovered.
CAS Number 4026-35-1
Product Name Mannopyranose, pentaacetate, beta-d-
IUPAC Name [(2R,3R,4S,5S,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate
Molecular Formula C16H22O11
Molecular Weight 390.34 g/mol
InChI InChI=1S/C16H22O11/c1-7(17)22-6-12-13(23-8(2)18)14(24-9(3)19)15(25-10(4)20)16(27-12)26-11(5)21/h12-16H,6H2,1-5H3/t12-,13-,14+,15+,16-/m1/s1
InChI Key LPTITAGPBXDDGR-RBGFHDKUSA-N
SMILES CC(=O)OCC1C(C(C(C(O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C
Canonical SMILES CC(=O)OCC1C(C(C(C(O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C
Isomeric SMILES CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H]([C@@H](O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C
CAS No: 4026-35-1 MDL No: MFCD00067370 Chemical Formula: C16H22O11 Molecular Weight: 390.34
COA:
Product : 1,2,3,4,6-Penta- O -acetyl-beta-D-mannopyranose, Btea-D-Mannose pentaacetate CAS : 4026-35-1
M .F. : C 16 H 22 O 11 M .W. : 390.34 Batch No : 20110420 Quantity :31 g
Items
Standards
Results
Appearance
White crystalline power
Positive
Solubility
Readily soluble in CHCl 3 and
insoluble in water
Positive
NMR and MS
Should comply
Complies
Identification
IR and TLC
Positive
Loss Weight On Dryness
Max. 1%
Complies
TLC (15%H 2 SO 4 -C 2 H 5 OH)
Should be one spot
Complies
Assay (HPLC)
Min. 98%
98.4%
References:
1. Akai, Kajihara Y, Nagashim Y, Kamei M, Arai J,, J. Carbohyd. Chem., 2001, 20, 2, p121