Di-O-isopropylidenea-D-allofuranose, CAS:2595-05-3

1,2:5,6-Di-O-isopropylidene-alpha-D-allofuranose: A Comprehensive Review of its Properties and Potential Applications 1. Definition and background 1,2:5,6-Di-O-isopropylidene-alpha-D-allofuranose (DIAP) is a carbohydrate compound that is widely used in various fields of research and industry. It is a derivative of D-allofuranose, which is a type of sugar that is commonly found in nature. DIAP is characterized by its isopropylidene group, which is added to the 1,2 and 5,6 positions of the sugar molecule. 2. Physical and Chemical Properties DIAP is a crystalline powder that is soluble in water and some organic solvents. It has a melting point of 101-103?C and a molecular weight of 260.28 g/mol. DIAP is a stable compound that is not easily hydrolyzed or oxidized. 3. Synthesis and Characterization DIAP can be synthesized from D-glucose or D-allofuranose through a series of chemical reactions. The synthesis involves protection of the 1,2 and 5,6 positions of the sugar molecule with isopropylidene groups using an acid catalyst. The product is then purified through crystallization and characterized using various spectroscopic techniques, such as NMR and IR. 4. Analytical Methods DIAP can be analyzed using various analytical methods, such as HPLC, GC, and MS. These techniques are used to determine the purity, identity, and concentration of DIAP in a sample. 5. Biological Properties DIAP has been shown to have various biological properties, such as antitumor, antifungal, and antiviral activities. These properties are attributed to the isopropylidene groups attached to the sugar molecule, which enhance its biological activity. 6. Toxicity and Safety in Scientific Experiments DIAP is generally considered safe and non-toxic in scientific experiments. However, its toxicity may depend on the dose and route of administration. Therefore, it is important to conduct toxicity studies to ensure its safety before using it in any scientific experiment. 7. Applications in Scientific Experiments DIAP has been widely used in scientific experiments, particularly in the field of organic chemistry. It is commonly used as a protecting group for hydroxyl groups of sugars, which allows for specific chemical reactions to occur. DIAP is also used as a chiral auxiliary in the synthesis of various organic compounds. 8. Current State of Research The current state of research on DIAP is focused on its potential applications in various fields, such as medicine, agriculture, and material science. Researchers are exploring various ways to modify and use DIAP as a tool for specific chemical reactions. There is also ongoing research on its biological properties and potential therapeutic applications. 9. Potential Implications in Various Fields of Research and Industry DIAP has potential implications in various fields of research and industry. It can be used in the synthesis of various organic compounds, such as pharmaceuticals, agrichemicals, and polymers. Its biological properties also make it a potential candidate for the development of new drugs. 10. Limitations and Future Directions One of the limitations of DIAP is its solubility in water, which can limit its applications in aqueous systems. However, researchers are exploring various ways to modify DIAP to improve its solubility and enhance its properties. Future directions of research on DIAP include exploring its potential applications in nanotechnology and in the development of new materials with specific properties. In conclusion, 1,2:5,6-Di-O-isopropylidene-alpha-D-allofuranose is a versatile compound with various applications in scientific research and industry. Its physical and chemical properties, synthesis, and potential applications have been reviewed in this paper. Ongoing research on DIAP and its potential implications in various fields show promise for its future use in various applications. CAS Number 2595-05-3 Product Name 1,2:5,6-Di-O-isopropylidene-alpha-D-allofuranose IUPAC Name (3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol Molecular Formula C12H20O6 Molecular Weight 260.28 g/mol InChI InChI=1S/C12H20O6/c1-11(2)14-5-6(16-11)8-7(13)9-10(15-8)18-12(3,4)17-9/h6-10,13H,5H2,1-4H3/t6-,7-,8-,9-,10-/m1/s1 InChI Key KEJGAYKWRDILTF-VVULQXIFSA-N SMILES CC1(OCC(O1)C2C(C3C(O2)OC(O3)(C)C)O)C Synonyms 1,2:5,6-Bis-O-(1-methylethylidene)-?-D-allofuranose; 1,2:5,6-Diacetone-D-allofuranose; Diacetone-D-allofuranose; Canonical SMILES CC1(OCC(O1)C2C(C3C(O2)OC(O3)(C)C)O)C Isomeric SMILES CC1(OC[C@@H](O1)[C@@H]2[C@H]([C@@H]3[C@H](O2)OC(O3)(C)C)O)C CAS No: 2595-05-3 MDL No: MFCD00135634 Chemical Formula: C12H20O6 Molecular Weight: 260.28 In Stock.?? COA: Product name: 1,2:5,6-Di-O-isopropylidene-a-D-allofuranose CAS: 2595-05-3 M.F. : C 12 H 20 O 6 M .W. : 260.28 Items Standards Results Appearance White crystal powder Complies Identification IR and HPLC Complies NMR and MS Should comply Comply Solubility Easily soluble in CH 2 Cl 2 , insoluble in Petroleum Complies Specific rotation [?]22/D, (c = 1, CHCl 3 ) +35? ~ +38? +37.6? Loss weight on dryness Max 0.5% 0.11% Residue on ignition Max. 0.5% 0.02% Assay by TLC Min. 98% 98.2% References: 1. David S, De Sennyey G, Carbohydr. Res. 1979, 77, p79