About this product
Difucosyl-para-lacto-N-hexaose II , DFpLNH II; Dimeric Lewis a-Lewis x octasaccharide linearDifucosyllacto-N-hexaose I (DFLNH) is a branched oligosaccharide known for its unique physical and biological properties. It is commonly found in human breast milk and is involved in various biological processes. Recently, DFLNH has gained the attention of the scientific community due to its potential applications in various fields of research and industry.Definition and Background:
DFLNH is an N-linked oligosaccharide, which consists of six sugars, including two fucose, three galactose, and one N-acetylglucosamine, linked to a protein molecule. It is a Type-2 Lewis antigen and is commonly found in human milk. Biologically, it is involved in various functions such as immune modulation and bacterial adhesion inhibition.Physical and Chemical Properties:
DFLNH is soluble in water and other polar solvents. It has a molecular weight of approximately 1,422 g/mol. The oligosaccharide consists of alpha-(1-2) and alpha-(1-3) linkages, making it resistant to hydrolysis by common glycosidases.Synthesis and Characterization:
DFLNH can be synthesized through various approaches such as chemoenzymatic synthesis and chemical synthesis. Characterization of DFLNH can be done through various spectroscopic techniques such as NMR, mass spectrometry, and X-ray crystallography.Analytical Methods:
DFLNH can be analyzed using various analytical methods such as high-performance liquid chromatography (HPLC), capillary electrophoresis, and nuclear magnetic resonance (NMR).Biological Properties:
DFLNH has various biological properties such as anti-inflammatory, anti-bacterial, anti-viral, and anti-tumor activity. It also plays a role in immune modulation by enhancing the proliferation of B cells and the production of cytokines.Toxicity and Safety in Scientific Experiments:
Studies have shown that DFLNH is non-toxic and safe for use in scientific experiments, with no significant adverse effects observed.Applications in Scientific Experiments:
DFLNH has potential applications in various fields of research and industry. It can be used as a biomarker for various diseases such as cancer and inflammatory bowel disease. DFLNH can also be used in drug discovery, as it has shown promising results in inhibiting bacterial adhesion and biofilm formation.Current State of Research:
Research on DFLNH is still in its early stages, and there is still much to be discovered about its biological mechanisms and potential applications. Studies are ongoing to elucidate its role in various diseases and to develop new drugs based on its structure.Potential Implications in Various Fields of Research and Industry:
The potential implications of DFLNH in various fields of research and industry are vast. It has the potential to be used as a therapeutic agent for various diseases, including cancer, autoimmune diseases, and infectious diseases. Industries such as pharmaceuticals, biotechnology, and food science can also benefit from its use.Limitations and Future Directions:
Despite its potential, there are still some limitations to the use of DFLNH. Its production can be costly and time-consuming, making it difficult to obtain large quantities for commercial use. Future research should focus on finding more cost-effective methods for production and exploring its potential applications in more depth.Future Directions:
1. Investigating the role of DFLNH in immune modulation and developing new immunotherapies based on its structure.2. Exploring its potential applications in food science, such as using it as a prebiotic to promote the growth of beneficial gut bacteria.3. Studying its potential as a diagnostic tool for various diseases, including autoimmune diseases and cancer.4. Developing more efficient methods for the production of DFLNH to make it more accessible for commercial use.5. Investigating its potential as a therapeutic agent for infectious diseases, such as malaria and tuberculosis.6. Exploring its potential as a novel drug for the treatment of neurological diseases such as Alzheimer's and Parkinson's disease.7. Investigating the potential of DFLNH in wound healing and tissue regeneration.8. Exploring the mechanism of action of DFLNH in inhibiting bacterial adhesion and biofilm formation for the development of new antibiotics.9. Studying the potential of DFLNH as a delivery system for drugs and therapeutics to target specific tissues and organs.10. Investigating the potential of DFLNH in the development of new vaccines and adjuvants.CAS Number64309-01-9Product NameDifucosyllacto-N-hexaose IIUPAC NameN-[2-[2-[5-acetamido-6-[3,5-dihydroxy-2-(hydroxymethyl)-6-(1,2,4,5-tetrahydroxy-6-oxohexan-3-yl)oxyoxan-4-yl]oxy-2-(hydroxymethyl)-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-6-(hydroxymethyl)-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]acetamideMolecular FormulaC52H88N2O39Molecular Weight1365.2 g/molInChIInChI=1S/C52H88N2O39/c1-12-25(66)31(72)34(75)48(80-12)88-40-21(10-60)85-47(24(54-15(4)63)43(40)91-50-36(77)33(74)28(69)18(7-57)82-50)93-45-30(71)20(9-59)84-52(38(45)79)89-41-22(11-61)86-46(23(53-14(3)62)42(41)90-49-35(76)32(73)26(67)13(2)81-49)92-44-29(70)19(8-58)83-51(37(44)78)87-39(17(65)6-56)27(68)16(64)5-55/h5,12-13,16-52,56-61,64-79H,6-11H2,1-4H3,(H,53,62)(H,54,63)InChI KeyBCUMESVDMXHZRL-UHFFFAOYSA-NSMILESCC1C(C(C(C(O1)OC2C(OC(C(C2OC3C(C(C(C(O3)CO)O)O)O)NC(=O)C)OC4C(C(OC(C4O)OC5C(OC(C(C5OC6C(C(C(C(O6)C)O)O)O)NC(=O)C)OC7C(C(OC(C7O)OC(C(CO)O)C(C(C=O)O)O)CO)O)CO)CO)O)CO)O)O)OCanonical SMILESCC1C(C(C(C(O1)OC2C(OC(C(C2OC3C(C(C(C(O3)CO)O)O)O)NC(=O)C)OC4C(C(OC(C4O)OC5C(OC(C(C5OC6C(C(C(C(O6)C)O)O)O)NC(=O)C)OC7C(C(OC(C7O)OC(C(CO)O)C(C(C=O)O)O)CO)O)CO)CO)O)CO)O)O)O