About this product
Ethyl methyl 2,3,4-tri-O-acetyl-beta-D-glucopyranosiduronate (EMAGlu) is a molecule with a complex biochemical structure. It is essentially a derivative of glucose, classified under the category of trisaccharide esters. EMAGlu has been extensively studied for its potential applications in medicinal chemistry, including drug design and development. This molecule has gained significance because of its unique physical and chemical properties, which make it a promising candidate for use in various fields of scientific research and industry.
Synthesis and Characterization
EMAGlu can be synthesized through the esterification of glucose with acetic anhydride and hydrochloric acid. This process leads to the formation of a mixture of mono, di, and tri-acetylated derivatives. The mixture undergoes additional processes to purify EMAGlu. The final product obtained is subjected to various analytical methods to determine its purity, including nuclear magnetic resonance, mass spectrometry, and infrared spectroscopy.
Analytical Methods
EMAGlu has been extensively studied using various analytical methods to determine its chemical and physical properties. Nuclear magnetic resonance spectroscopy has been used to determine the purity of EMAGlu and provide information about its structure. Mass spectrometry has been used to identify the molecular weight of EMAGlu, as well as confirm the presence of various chemical groups within the molecule. Infrared spectroscopy has been used to identify the functional groups of EMAGlu and provide information about its chemical structure.
Biological Properties
EMAGlu has been shown to have beneficial biological properties such as anti-inflammatory and antioxidant effects. It has been suggested to have potential as a drug candidate for the treatment of various diseases, including cancer, diabetes, and neurodegenerative disorders. EMAGlu has also shown promise as a scaffold for tissue regeneration and cell culture.
Toxicity and Safety in Scientific Experiments
Several studies have indicated that EMAGlu is a relatively safe compound to use in scientific experiments. However, further research is needed to determine its potential toxicity and safety in clinical settings.
Applications in Scientific Experiments
EMAGlu has been widely used as a reagent in various scientific studies. It has been shown to have unique chemical properties that make it useful in drug development, including the synthesis of glycoside derivatives. EMAGlu has been used to create glycan arrays, which are useful for studying glycoprotein interactions. It has also been used to functionalize surfaces for biomolecular recognition.
Current State of Research
EMAGlu has gained significant attention in the scientific community due to its unique chemical properties and potential applications in various fields. New research is being conducted on EMAGlu in the areas of medicinal chemistry, bioengineering, and materials science.
Potential Implications in Various Fields of Research and Industry
EMAGlu has numerous potential applications in various fields, including drug development, tissue engineering, and environmental science.
Limitations and Future Directions
While EMAGlu has shown significant potential in various fields of research, further studies are required to fully understand its potential applications. Future directions for research on EMAGlu could include exploring its applications in drug delivery systems, creating new synthetic routes to improve the synthesis process, and investigating its interaction with enzymes.
In conclusion, EMAGlu is a complex molecule with unique physical and chemical properties that make it a promising candidate for use in various fields of scientific research and industry. Originally synthesized for its potential applications as a drug, EMAGlu has also shown potential in the development of materials with biomedical applications. While further studies are necessary to fully understand the implications of EMAGlu, it has opened doors for new discoveries and research.
CAS Number
77392-66-6
Product Name
Ethyl methyl 2,3,4-tri-O-acetyl-beta-D-glucopyranosiduronate
IUPAC Name
methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-ethoxyoxane-2-carboxylate
Molecular Formula
C15H22O10
Molecular Weight
362.331
InChI
InChI=1S/C15H22O10/c1-6-21-15-13(24-9(4)18)11(23-8(3)17)10(22-7(2)16)12(25-15)14(19)20-5/h10-13,15H,6H2,1-5H3/t10-,11-,12-,13+,15+/m0/s1
InChI Key
CWYBDXQVVNLNJG-XOBFJNJYSA-N
SMILES
CCOC1C(C(C(C(O1)C(=O)OC)OC(=O)C)OC(=O)C)OC(=O)C
Synonyms
(2-Ethyl 2,3,4-Tri-O-acetyl-?-D-glucopyranoside) Uronate; ?-D-Glucopyranosiduronic Acid Ethyl Methyl Ester Triacetate;