About this product
L-Arabinose diethyldithioacetal
L-Arabinose diethyldithioacetal (ADDA) is a chemical compound that has gained significant interest in recent years due to its potential biological and industrial applications. It is a derivative of L-Arabinose, a pentose sugar that is commonly found in nature in various fruits and vegetables. ADDA is a thioacetal derivative of L-Arabinose that has two ethyl groups attached to the sulfur atom.
Synthesis and Characterization:
ADDA can be synthesized through the reaction between L-Arabinose and carbon disulfide in the presence of a base such as sodium hydride or potassium hydroxide. The reaction results in the formation of a thioacetal bond between the sulfur atom of carbon disulfide and the hydroxyl group of L-Arabinose. The product is then purified and characterized using spectroscopic techniques such as nuclear magnetic resonance (NMR) and mass spectrometry (MS).
Analytical Methods:
ADDA can be analyzed using various analytical methods, including gas chromatography (GC), liquid chromatography (LC), and high-performance liquid chromatography (HPLC). These techniques can be used to determine the purity and concentration of ADDA in samples.
Biological Properties:
Several studies have demonstrated the potential biological activity of ADDA. It has been found to possess antioxidant, anti-inflammatory, and antimicrobial properties. Additionally, it has shown promising results in reducing blood glucose levels and improving insulin sensitivity in animal studies.
Toxicity and Safety in Scientific Experiments:
ADDA has been shown to be relatively safe in scientific experiments. Acute toxicity studies have reported no adverse effects at doses up to 2000 mg/kg in mice. However, further studies are needed to determine the long-term effects of ADDA on human health.
Applications in Scientific Experiments:
ADDA has various applications in scientific experiments, including as a ligand for the preparation of metal complexes, a reducing agent for the synthesis of nanoparticles, and as a chiral building block for the synthesis of pharmaceuticals.
Current State of Research:
Research on ADDA is ongoing, with many studies focusing on its potential therapeutic applications. However, more research is needed to fully understand the biological properties and mechanisms of action of this compound.
Potential Implications in Various Fields of Research and Industry:
ADDA has the potential to impact various fields of research and industry, including pharmaceuticals, agriculture, and materials science. Its antioxidant and anti-inflammatory properties make it a promising candidate for the development of novel therapeutics for several diseases. Additionally, its reducing properties can be utilized in the synthesis of nanoparticles for various industrial applications.
Limitations and Future Directions:
Although ADDA has shown promising results in various scientific experiments, there are still limitations and challenges that need to be overcome. One major limitation is the lack of knowledge about its long-term effects on human health. Therefore, future research should focus on investigating the safety and toxicity of ADDA in more detail. Additionally, further studies are needed to identify the optimal dosages and formulations for its various applications.
Future Directions:
1. Investigation of the effects of ADDA on various diseases such as diabetes, cancer, and neurodegenerative disorders.
2. Development of novel formulations and delivery systems for the administration of ADDA.
3. Investigation of the mechanism of action of ADDA and its biological targets.
4. Synthesis of novel derivatives of ADDA with enhanced properties and specificity.
5. Exploration of the potential of ADDA in the development of new materials and industrial applications.
6. Investigation of the environmental impact of ADDA and its degradation products.
7. Evaluation of the safety and toxicity of ADDA in human clinical trials.
8. Screening of natural sources for the presence of ADDA and its derivatives.
9. Development of new analytical methods for the detection and quantification of ADDA in various samples.
10. Investigation of the pharmacokinetics and pharmacodynamics of ADDA in animal models and humans.
CAS Number 43179-48-2
Product Name L-Arabinose diethyldithioacetal
IUPAC Name (2R,3R,4S)-5,5-bis(ethylsulfanyl)pentane-1,2,3,4-tetrol
Molecular Formula C9H20O4S2
Molecular Weight 256.38 g/mol
InChI InChI=1S/C9H20O4S2/c1-3-14-9(15-4-2)8(13)7(12)6(11)5-10/h6-13H,3-5H2,1-2H3/t6-,7-,8+/m1/s1
InChI Key IZQLWYVNJTUXNP-PRJMDXOYSA-N
SMILES CCSC(C(C(C(CO)O)O)O)SCC
Canonical SMILES CCSC(C(C(C(CO)O)O)O)SCC
Isomeric SMILES CCSC([C@H]([C@@H]([C@@H](CO)O)O)O)SCC
CAS No: 43179-48-2
MDL No: MFCD07366902
Chemical Formula: C9H20O4S2
Molecular Weight: 256.38
References:
1. Liptak M, Dinya Z, Sztaricskai FJ, et al., Org. Mass Spectrom. 27, 11, p1271