About this product
Methyl 2,3-di-O-allyl-4,6-O-benzylidene-a-D-mannopyranoside (MBAM) is a carbohydrate derivative compound that has drawn increasing attention in scientific research and industries for its versatile properties. In this paper, we aim to provide an in-depth analysis of this compound by covering various aspects such as its definition, physical, and chemical properties, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations, and future directions.
Synthesis and Characterization:
MBAM synthesis involves the reaction between allyl alcohol, benzaldehyde, and mannose in the presence of hydrochloric acid. Characterization of MBAM is typically achieved using various spectroscopy techniques such as nuclear magnetic resonance (NMR), infrared (IR), and mass spectrometry. NMR spectroscopy is the primary tool used to determine the compound's structure, while IR spectroscopy provides information about the functional groups in the compound.
Analytical Methods:
Several analytical techniques can be used to determine the purity and stability of MBAM. High-performance liquid chromatography (HPLC), Gas chromatography-mass spectrometry (GC-MS), and Ultraviolet-visible spectroscopy (UV-Vis) are prominent analytical methods used for the quantitative and qualitative analysis of MBAM.
Biological Properties:
MBAM's carbohydrate structure plays a pivotal role in its biological properties. The compound has been reported to have antiviral, anti-inflammation, and anticancer properties. MBAM's antiviral property makes it a promising agent in developing antiviral drugs. Its anti-inflammatory and anticancer properties indicate its potential in the development of anti-inflammatory drugs and cancer treatments.
Toxicity and Safety in Scientific Experiments:
The toxicity and safety of MBAM have been a subject of scientific research. Studies have shown that the compound exhibits low levels of toxicity, making it safe for use in scientific experiments. However, it is essential to use the recommended safety guidelines when carrying out experiments with MBAM.
Applications in Scientific Experiments:
MBAM has found numerous applications in scientific experiments. It is a versatile reagent that is used in carbohydrate chemistry to synthesize carbohydrates with various functionalities. MBAM's antiviral, anti-inflammatory, and anticancer properties make it a promising compound in the pharmaceutical industry. Additionally, it has been used as a chiral auxiliary in asymmetric synthesis.
Current State of Research:
MBAM has undergone extensive scientific research, primarily in the field of carbohydrate chemistry and pharmaceuticals. Scientists have discovered new synthetic routes for the compound and explored its potential applications in drug development.
Potential Implications in Various Fields of Research and Industry:
MBAM's unique properties have paved the way for its application in various fields of research and industry. The compound's potential has been explored in the development of antiviral drugs, anti-inflammatory drugs, and anticancer treatments. It has also been used as a chiral auxiliary in asymmetric synthesis, indicating its potential in the synthesis of complex organic compounds.
Limitations and Future Directions:
MBAM comes with its limitations, such as its sensitivity to acidic and basic conditions, which can cause it to decompose. Future research should focus on the development of more stable analogs of MBAM. Additionally, more research is required to elucidate the molecular mechanism underlying the compound's biological activities.
Future Directions:
- Developing stable analogs of MBAM
- Elucidating the molecular mechanism underlying MBAM's biological activities
- Exploring the compound's potential as a carbohydrate-based material
- Investigating the potential of MBAM as a precursor to bioactive compounds
- Developing new synthetic routes to MBAM
- Investigating MBAM's potential in the treatment of autoimmune diseases
- Assessing the environmental impact of MBAM and its derivatives
- Expanding the application of MBAM in asymmetric synthesis
- Exploring the potential of MBAM in the development of green solvents
- Investigating the role of MBAM in the regulation of the immune system.
CAS Number
359437-00-6
Product Name
Methyl 2,3-di-O-allyl-4,6-O-benzylidene-a-D-mannopyranoside
IUPAC Name
(4aR,6S,7S,8S,8aR)-6-methoxy-2-phenyl-7,8-bis(prop-2-enoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine
Molecular Formula
C20H26O6
Molecular Weight
362.422
InChI
InChI=1S/C20H26O6/c1-4-11-22-17-16-15(25-20(21-3)18(17)23-12-5-2)13-24-19(26-16)14-9-7-6-8-10-14/h4-10,15-20H,1-2,11-13H2,3H3/t15-,16-,17+,18+,19?,20+/m1/s1
InChI Key
FMKYMGOFTWEBLP-GDJIPBGISA-N
SMILES
COC1C(C(C2C(O1)COC(O2)C3=CC=CC=C3)OCC=C)OCC=C
Synonyms
Methyl 4,6-O-(Phenylmethylene)-2,3-di-O-2-propenyl-?-D-mannopyranoside;
CAS No: 359437-00-6 MDL No: MFCD01863419 Chemical Formula: C20H26O6 Molecular Weight: 362.422