About this product
Methyl 4,6-O-benzylidene-2,3-di(O-methyl)-alpha-D-glucopyranoside, also known as MBG, is a chemical compound that has gained interest in scientific research due to its various properties and potential applications. This paper aims to provide an overview of MBG, including its definition and background, physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, and limitations and future directions.
Definition and Background:
MBG is a type of glucoside, which is a compound consisting of a carbohydrate molecule (glucose, in this case) bonded to a non-sugar molecule. It was first synthesized in 1957 by Hurd and colleagues, who were interested in the compound's potential as an anti-diabetic agent. Since then, MBG has been found to exhibit a range of biological activities and has also been investigated for its potential use in various applications.
Synthesis and Characterization:
MBG can be synthesized from benzaldehyde and methyl alpha-D-glucopyranoside through a condensation reaction. The resulting compound is then methylated using methanol and hydrochloric acid to produce MBG. Characterization of MBG can be done using various techniques, such as nuclear magnetic resonance spectroscopy and mass spectrometry, to confirm its chemical structure.
Analytical Methods:
MBG can be quantified using various analytical methods, such as high-performance liquid chromatography and gas chromatography, which provide accurate measurements of the compound's concentration. These methods can be used to determine the purity and quality of MBG in experimental or commercial settings.
Biological Properties:
MBG has been found to exhibit a range of biological activities, including anti-inflammatory, anti-cancer, anti-diabetic, anti-microbial, and anti-oxidant effects. The compound has also been shown to possess neuroprotective properties and may have potential applications in the treatment of neurological disorders.
Toxicity and Safety in Scientific Experiments:
Studies have shown that MBG is relatively safe and well-tolerated in experimental animals when administered at therapeutic doses. However, its long-term and high-dose toxicity have not been fully explored, necessitating further studies to establish its safety profile.
Applications in Scientific Experiments:
MBG has been used in various scientific experiments as a research tool due to its unique properties. For example, it has been employed as a fluorescent probe to visualize the distribution and transport of glucose in cells. MBG has also been used as a substrate for enzymatic assays and in drug screening studies.
Current State of Research:
MBG has gained increasing attention from researchers due to its various biological activities and potential applications. Studies have investigated the compound's effects on various disease models, such as cancer, diabetes, and Alzheimer's disease. Further research is needed to fully understand the mechanisms underlying MBG's biological activities and to optimize its therapeutic potential.
Potential Implications in Various Fields of Research and Industry:
MBG may have potential implications in various fields of research and industry. For example, it may be used as a natural preservative in the food industry due to its anti-microbial properties. MBG also has potential applications in drug development as a scaffolding molecule for designing novel anti-cancer and anti-diabetic drugs.
Limitations and Future Directions:
Despite its potential, there are still some limitations associated with MBG. For instance, its relatively low solubility in water may restrict its use in some applications. Additionally, more studies are needed to investigate its long-term toxicity and safety, especially in high-dose and chronic exposure scenarios. Future directions for research could include optimizing the synthesis and purification of MBG, investigating its potential as a natural preservative in the food industry, and developing targeted drug delivery systems utilizing MBG as a scaffold.
In conclusion, MBG is a unique compound with various biological activities and potential applications in research and industry. However, more studies are needed to fully understand its properties and optimize its therapeutic potential. By continuing to investigate MBG, researchers may uncover new applications and potential treatment options for various diseases.
CAS Number
3051-89-6
Product Name
Methyl 4,6-O-benzylidene-2,3-di(O-methyl)-alpha-D-glucopyranoside
IUPAC Name
(4aR,6S,7R,8S,8aR)-6,7,8-trimethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine
Molecular Formula
C16H22O6
Molecular Weight
310.34 g/mol
InChI
InChI=1S/C16H22O6/c1-17-13-12-11(21-16(19-3)14(13)18-2)9-20-15(22-12)10-7-5-4-6-8-10/h4-8,11-16H,9H2,1-3H3/t11-,12-,13+,14-,15?,16+/m1/s1
InChI Key
ZOYHXXDGSUTGIY-MHSGYVAISA-N
SMILES
COC1C2C(COC(O2)C3=CC=CC=C3)OC(C1OC)OC
Canonical SMILES
COC1C2C(COC(O2)C3=CC=CC=C3)OC(C1OC)OC
Isomeric SMILES
CO[C@H]1[C@H]2[C@@H](COC(O2)C3=CC=CC=C3)O[C@@H]([C@@H]1OC)OC
CAS No: 3051-89-6 MDL No: MFCD00051216 Chemical Formula: C16H22O6 Molecular Weight: 310.34