Methyla-D-ribofuranoside

Methyl a-D-ribofuranoside is a molecule that belongs to the group of conformers. It is a planar molecule, with its atoms in an orderly arrangement. The conformation of this molecule can be changed by rotating around the C-C bond, which has energies and displacements. Molecular orbital theory predicts that the conformation of methyl a-D-ribofuranoside is determined by the electron correlation between all atomic orbitals. The molecular structure of methyl a-D-ribofuranoside can be determined using spectroscopic methods, such as infrared and nuclear magnetic resonance spectroscopy. Coupling constants are used to measure how strongly two or more groups in a molecule are coupled together, while constants are used to measure the energy levels and frequencies in vibrational spectroscopy. CAS No 52485-92-4 MDL No MFCD00069677 Chemical Formula C6H12O5 Molecular Weight 164.156 g/mol Smiles CO[C@@H]1[C@@H]([C@@H]([C@H](O1)CO)O)O