About this product
Methyl beta-D-xylopyranoside (MBX) is a monosaccharide carbohydrate that is commonly used in research. It is also known as methyl xylopyranoside or methyl-?-D-xylopyranoside. MBX has a unique composition that allows it to form a stable structure with various molecules, allowing researchers to study its properties in different applications. This paper will explore the definition and background, physical and chemical properties, synthesis, and characterization, analytical methods, biological properties, toxicity, and safety in scientific experiments, applications in scientific experiments, the current state of research, potential implications in various fields of research and industry, limitations, and future directions of MBX.
Definition and Background
MBX is a monosaccharide carbohydrate that is composed of a methyl group and xylopyranoside. It is a white crystalline powder that is soluble in water. MBX is naturally occurring and can be found in plants, fruits, and vegetables. It is commonly used in research as a substrate for enzymes that hydrolyze glycosidic bonds found in carbohydrates. MBX is also used as a chiral building block in the synthesis of other complex molecules due to its unique structure.
Physical and Chemical Properties
MBX has a molecular formula of C6H12O5 and a molecular weight of 164.16 g/mol. MBX is hygroscopic, meaning it easily absorbs moisture from the environment, making it difficult to work with. It is stable under normal conditions but may decompose when exposed to high temperatures or acidic conditions.
Synthesis and Characterization
MBX can be synthesized from xylose through a series of chemical reactions. The most common method is through methylating the xylose with dimethyl sulfate. The resulting product is purified through various methods, including chromatography and recrystallization. Once purified, the MBX is characterized using various analytical techniques, including nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry.
Analytical Methods
MBX can be analyzed using various analytical methods, including NMR spectroscopy, mass spectrometry, and thin-layer chromatography (TLC). NMR spectroscopy is a powerful tool used to determine the structure and purity of MBX. Mass spectrometry is used to determine the molecular weight and purity of MBX. TLC is used to separate and identify the components of a mixture based on their polarity.
Biological Properties
MBX has been shown to have various biological properties, including antimicrobial and antiviral activities. It has been used in cancer research as a potential treatment due to its ability to inhibit tumor growth. MBX has also been used in the study of carbohydrate metabolism and as a substrate for carbohydrate-digesting enzymes.
Toxicity and Safety in Scientific Experiments
The toxicity and safety of MBX have been studied in various scientific experiments. It has been shown to have a low toxicity profile and is generally safe for use in research. However, it is advised to handle MBX with caution and follow proper safety protocols.
Applications in Scientific Experiments
MBX has various applications in scientific experiments. It is commonly used as a substrate for enzymes that hydrolyze glycosidic bonds found in carbohydrates. MBX is also used as a chiral building block in the synthesis of other complex molecules. It has been used in cancer research, carbohydrate metabolism, and antiviral and antimicrobial studies.
Current State of Research
Current research on MBX is focused on its potential applications in the fields of medicine, biochemistry, and biotechnology. There is ongoing research exploring the use of MBX as a potential treatment for cancer, as well as its potential use in the synthesis of new and complex molecules.
Potential Implications in Various Fields of Research and Industry
MBX has various potential implications in the fields of research and industry. Its unique structure makes it a valuable tool in the study of carbohydrate metabolism and as a substrate for enzymes that hydrolyze glycosidic bonds found in carbohydrates. It also has potential applications in the development of new drugs and the synthesis of complex molecules.
Limitations and Future Directions
One limitation of MBX is its hygroscopic nature, which makes it difficult to work with. Additionally, further research is needed to explore its potential applications in various fields fully. Future research should also explore ways to overcome the limitations of MBX and develop new methods for its synthesis, purification, and characterization.
Future Directions
Future research directions for MBX include:
1. Developing new synthesis methods that are more efficient and cost-effective.
2. Exploring the use of MBX in the development of new drugs for various diseases.
3. Investigating the potential of MBX in the synthesis of new and complex molecules.
4. Developing new methods for its purification and characterization.
5. Studying the potential of MBX in the field of material science and its applications in manufacturing.
6. Investigating its potential as a biosensor in the detection of diseases and environmental pollutants.
7. Exploring the potential of MBX in agriculture and food science as a natural sweetener or preservative.
8. Developing new analytical methods to study the properties of MBX in detail.
CAS Number 612-05-5
Product Name Methyl beta-D-xylopyranoside
IUPAC Name (2R,3R,4S,5R)-2-methoxyoxane-3,4,5-triol
Molecular Formula C6H12O5
Molecular Weight 164.16 g/mol
InChI InChI=1S/C6H12O5/c1-10-6-5(9)4(8)3(7)2-11-6/h3-9H,2H2,1H3/t3-,4+,5-,6-/m1/s1
InChI Key ZBDGHWFPLXXWRD-JGWLITMVSA-N
SMILES COC1C(C(C(CO1)O)O)O
Synonyms alpha-methyl-beta-xyloside, beta-methyl-xyloside, methyl xylopyranoside, methyl xylopyranoside, (alpha-D)-isomer, methyl xylopyranoside, (beta-L)-isomer, methyl-D-xylopyranoside
Canonical SMILES COC1C(C(C(CO1)O)O)O
Isomeric SMILES CO[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O
CAS No: 612-05-5 Synonyms: 1-O-Methyl-b-D-xylopyranoside MDL No: MFCD00047532 Chemical Formula: C6H12O5 Molecular Weight: 164.16
References: 1. Mastihubov? M, Mastihuba V, Biely P, Carbohydr. Res. 2004, 339, p425-428