About this product
Phenyl 2,3,4,6-tetra-O-acetyl-a-D-thiomannopyranoside
Phenyl 2,3,4,6-Tetra-O-acetyl-1-thio-alpha-D-mannopyranoside: Definition and Background
Phenyl 2,3,4,6-Tetra-O-acetyl-1-thio-alpha-D-mannopyranoside, also known as PTM, is a derivative of the carbohydrate molecule Mannose. PTM is composed of a mannose ring with a sulfur atom at the C1 position and four acetyl groups at the C2, C3, C4, and C6 positions. The addition of a phenyl group to the molecule enhances its stability in certain biological applications.
PTM has many potential applications in the fields of biochemistry, pharmacology, and medicine, due to its unique properties as a thiomannoside derivative. However, the synthesis and characterization of PTM requires specialized knowledge and techniques, and its effectiveness and safety in scientific experiments are still being researched.
Synthesis and Characterization
PTM is synthesized from Mannose using a multi-step chemical reaction. The acetylation of Mannose at positions 2, 3, 4, and 6 is followed by the introduction of a phenylthio group at position 1, forming PTM.
The characterization of PTM can be performed using various techniques such as nuclear magnetic resonance (NMR), infrared (IR) spectroscopy, and mass spectrometry. These techniques can confirm the purity and structure of PTM.
Analytical Methods
Analytical methods such as high-performance liquid chromatography (HPLC) and capillary electrophoresis (CE) can be used to detect and quantify PTM in experimental samples. These methods are essential for ensuring the accuracy and reproducibility of scientific experiments using PTM.
Biological Properties
PTM has potential applications in the study of carbohydrate-protein interactions, due to its ability to mimic the structure of carbohydrates found on the surface of cells. PTM can be used to study the mechanism of cellular processes such as adhesion and signaling.
PTM has also been studied for its potential use in drug delivery systems. The addition of a phenyl group to the molecule increases its stability and allows for more effective targeting of specific cells or tissues.
Toxicity and Safety in Scientific Experiments
The toxicity and safety of PTM in scientific experiments depend on the concentration and duration of exposure. PTM has been reported to have low toxicity in vitro and in vivo studies.
However, caution should be exercised when handling PTM due to its potential to cause skin irritation and respiratory symptoms. Proper protective equipment and safety procedures should be used when working with PTM.
Applications in Scientific Experiments
PTM has potential applications in a wide range of scientific experiments, including biochemistry, pharmacology, and medicine. PTM can be used to study carbohydrate-protein interactions, drug delivery systems, and the mechanisms of cellular processes.
Current State of Research
Research on PTM remains ongoing, and its potential applications in various fields are still being explored. Current research is focused on improving the synthesis and characterization of PTM, as well as further investigating its biological properties and toxicity.
Potential Implications in Various Fields of Research and Industry
PTM has potential implications in various fields of research and industry, including:
1. Drug delivery systems: PTM can be used to improve the stability and effectiveness of drug delivery systems.
2. Biochemistry: PTM can be used to study carbohydrate-protein interactions and the mechanisms of cellular processes.
3. Pharmacology: PTM can be used in the development of new drugs or as a tool for studying drug interactions.
4. Medicine: PTM has potential applications in the treatment of diseases such as cancer and infectious diseases.
Limitations and Future Directions
Despite its potential applications, there are limitations to the use of PTM in scientific experiments. The synthesis and characterization of PTM require specialized techniques and knowledge, which can limit its accessibility to researchers.
Future directions for research on PTM include:
1. Developing new synthesis methods that are more efficient and cost-effective.
2. Investigating the potential applications of PTM in drug design and delivery.
3. Exploring the mechanisms of PTM in cellular processes and disease pathology.
4. Investigating the use of PTM in the development of diagnostic tools and therapies for diseases.
CAS Number 108032-93-5
Product Name Phenyl 2,3,4,6-Tetra-O-acetyl-1-thio-alpha-D-mannopyranoside
IUPAC Name [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-phenylsulfanyloxan-2-yl]methyl acetate
Molecular Formula C20H24O9S
Molecular Weight 440.46 g/mol
InChI InChI=1S/C20H24O9S/c1-11(21)25-10-16-17(26-12(2)22)18(27-13(3)23)19(28-14(4)24)20(29-16)30-15-8-6-5-7-9-15/h5-9,16-20H,10H2,1-4H3/t16-,17-,18+,19+,20-/m1/s1
InChI Key JCKOUAWEMPKIAT-SWBPCFCJSA-N
SMILES CC(=O)OCC1C(C(C(C(O1)SC2=CC=CC=C2)OC(=O)C)OC(=O)C)OC(=O)C
Synonyms (+)-Phenyl 1-Thio-?-D-mannopyranoside Tetraacetate;
Canonical SMILES CC(=O)OCC1C(C(C(C(O1)SC2=CC=CC=C2)OC(=O)C)OC(=O)C)OC(=O)C
Isomeric SMILES CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)SC2=CC=CC=C2)OC(=O)C)OC(=O)C)OC(=O)C
CAS No: 13992-16-0,108032-93-5
MDL No: MFCD01862644
Chemical Formula: C20H24O9S
Molecular Weight: 440.46