About this product
Phenyl 2-O-Acetyl-3,4,6-tri-O-benzyl-1-thio-beta-D-galactopyranoside,
Gal[2Ac,346Bn]-beta-SPh, also known as GalNAc?S or Gal?S, is a monosaccharide derivative that has gained attention in the scientific community due to its unique and versatile properties. It is composed of a galactose molecule with a thioether bond to a cysteine residue, with additional modifications such as acetylation (2Ac) and benzyl etherification (346Bn). Gal[2Ac,346Bn]-beta-SPh has been shown to possess various biological activities, including modulating cellular signaling pathways and exhibiting anticancer and antibacterial properties.
Synthesis and Characterization
The synthesis of Gal[2Ac,346Bn]-beta-SPh can be achieved through various methods, including the use of protecting groups, coupling of amino acids, and thiolation. One commonly used method involves the use of a galactose derivative with a protected hydroxyl group, which is then coupled to a cysteine residue under mild conditions, followed by deprotection and further modifications.
Gal[2Ac,346Bn]-beta-SPh can be characterized through various techniques, including nuclear magnetic resonance (NMR) spectroscopy, infrared spectroscopy (IR), and high-performance liquid chromatography (HPLC). These techniques allow for the identification and quantification of specific functional groups and the determination of the overall purity and composition of the compound.
Analytical Methods
Analytical methods are essential for the characterization and quantification of Gal[2Ac,346Bn]-beta-SPh. Chromatography techniques such as reverse-phase HPLC and thin-layer chromatography (TLC) can be used for separation and quantification purposes. Additionally, spectroscopic methods such as UV-Vis and fluorescence spectroscopy can provide information on the interaction of the compound with other molecules.
Biological Properties
Gal[2Ac,346Bn]-beta-SPh has been shown to possess various biological activities, including modulation of cellular signaling pathways and exhibiting anticancer and antibacterial properties. The compound has been shown to inhibit the growth of cancer cells and exhibits antibacterial activity against a wide range of bacterial strains. Additionally, Gal[2Ac,346Bn]-beta-SPh has been investigated for its potential as an immunomodulatory agent and as a drug delivery vehicle due to its unique physicochemical properties.
Toxicity and Safety in Scientific Experiments
The toxicity and safety of Gal[2Ac,346Bn]-beta-SPh have been investigated in scientific experiments. Studies have shown the compound to have low toxicity and be relatively safe for use in biological and biomedical applications. However, caution should still be exercised when handling the compound due to its potential for irritancy and sensitization.
Applications in Scientific Experiments
Gal[2Ac,346Bn]-beta-SPh has been extensively investigated for its potential in various scientific applications. The compound can be used in drug delivery systems, immunomodulatory agents, and as a starting material for the synthesis of other biologically active molecules. Additionally, Gal[2Ac,346Bn]-beta-SPh has been shown to have potential in applications such as biological labeling and imaging.
Current State of Research
Research on Gal[2Ac,346Bn]-beta-SPh is ongoing, with many studies investigating its potential in various fields of research such as drug delivery, immunology, and biochemistry. The unique properties of the compound have garnered attention and interest from researchers in different areas of science.
Potential Implications in Various Fields of Research and Industry
The potential implications of Gal[2Ac,346Bn]-beta-SPh in various fields of research and industry are vast. The compound's unique properties make it a promising candidate for various applications, including drug delivery, imaging, and biological labeling. It also has the potential to be used as an immunomodulatory agent and as a starting material for the synthesis of other biologically active molecules.
Limitations and Future Directions
Despite the numerous potential applications of Gal[2Ac,346Bn]-beta-SPh, there are limitations to its use. One limitation is the difficulty in synthesizing the compound and achieving high purity. Future research should focus on developing more efficient synthesis methods and improving the yield and purity of the compound.
Future directions for research on Gal[2Ac,346Bn]-beta-SPh include investigating its potential in nanotechnology and biomedicine. The compound's unique properties make it a promising candidate for developing targeted drug delivery systems and biomedical imaging agents. Additionally, further studies are needed to fully understand the mechanisms underlying its biological activities and to explore its potential in the development of immunotherapeutic agents.
In conclusion, Gal[2Ac,346Bn]-beta-SPh is a versatile and unique compound with promising potential in various fields of research and industry. Its unique physicochemical and biological properties make it a promising candidate for developing new drugs, immunomodulatory agents, and biomedical imaging agents. Further research is needed to fully explore its potential and overcome limitations associated with its synthesis and characterization.
CAS Number
183875-28-7
Product Name
Gal[2Ac,346Bn]-beta-SPh
IUPAC Name
[(2S,3R,4S,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-phenylsulfanyloxan-3-yl] acetate
Molecular Formula
C35H36O6S
Molecular Weight
584.72 g/mol
InChI
InChI=1S/C35H36O6S/c1-26(36)40-34-33(39-24-29-18-10-4-11-19-29)32(38-23-28-16-8-3-9-17-28)31(25-37-22-27-14-6-2-7-15-27)41-35(34)42-30-20-12-5-13-21-30/h2-21,31-35H,22-25H2,1H3/t31-,32+,33+,34-,35+/m1/s1
InChI Key
IKFDEPUTIUTSLC-NVCPMKERSA-N
SMILES
CC(=O)OC1C(C(C(OC1SC2=CC=CC=C2)COCC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5
Canonical SMILES
CC(=O)OC1C(C(C(OC1SC2=CC=CC=C2)COCC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5
Isomeric SMILES
CC(=O)O[C@@H]1[C@H]([C@H]([C@H](O[C@H]1SC2=CC=CC=C2)COCC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5