About this product
2,3,4,6-Tetra-O-acetyl-a-D-galactopyranosyl azide, 2,3,4,6-Tetra-O-acetyl-?-D-galactopyranosyl azide (Ac4GalNAz) is a monosaccharide derivative used in biological applications such as imaging, labeling, and detecting glycans in vivo and in vitro. Ac4GalNAz is a substrate for bio-orthogonal chemical reactions, and it undergoes click chemistry, a type of chemical reaction that is both fast and selective.Synthesis and Characterization:
Ac4GalNAz is synthesized via a series of chemical reactions, including the coupling of 2,3,4,6-tetra-O-acetyl-?-D-galactopyranosyl chloride with sodium azide or lead azide to form Ac4GalNAz. The compound is purified using organic solvents such as methanol or ethyl acetate. Characterization of Ac4GalNAz is performed using spectroscopic techniques such as nuclear magnetic resonance (NMR) spectroscopy and high-resolution mass spectrometry.Analytical Methods:
Ac4GalNAz can be detected using various analytical methods such as fluorescent microscopy, flow cytometry, and mass spectrometry. Fluorescent microscopy and flow cytometry are used to visualize and quantify the labeled glycans in living cells, while mass spectrometry is used to identify the labeled glycans in complex mixtures.Biological Properties:
Ac4GalNAz is non-toxic and does not affect cellular functions. This compound is metabolized to uridine diphosphate (UDP)-GalNAz and incorporated into glycans by glycosyltransferases. The labeled glycans can then be detected using bio-orthogonal labeling techniques.Toxicity and Safety in Scientific Experiments:
Ac4GalNAz is considered safe for use in scientific experiments. However, like any chemical compound, Ac4GalNAz should be handled with care, and proper safety precautions should be taken when working with this compound.Applications in Scientific Experiments:
Ac4GalNAz is used in various scientific experiments, including imaging of glycan biosynthesis, metabolic labeling of glycosylation, and proteomic studies. This compound can be used to visualize specific glycans in living cells and to study the dynamics of glycan biosynthesis. Ac4GalNAz is also used for the detection and quantification of glycoproteins and glycolipids.Current State of Research:
Ac4GalNAz has gained popularity in the field of glycobiology, and there has been an increase in research on the compound's synthesis, characterization, and applications. Current research is focused on the development of new bio-orthogonal chemical reactions, labeling techniques, and imaging strategies using Ac4GalNAz.Potential Implications in Various Fields of Research and Industry:
Ac4GalNAz has potential applications in various fields of research and industry, including drug discovery, biomarker discovery, and disease diagnosis. This compound can be used to identify specific glycoforms associated with diseases such as cancer, diabetes, and neurodegenerative disorders. Ac4GalNAz can also be used to identify new drug targets and to develop glycan-based therapeutics.Limitations and Future Directions:
One limitation of using Ac4GalNAz is its limited bioavailability and the requirement for metabolic modification to incorporate the labeled glycans. Future research is focused on the development of new metabolic labeling strategies and imaging techniques to overcome these limitations. Additionally, there is a need for more studies to investigate the potential applications of Ac4GalNAz in various fields of research and industry. Some future directions include optimization of labeling efficiency, development of new click chemistry reactions, and identification of novel glycan biomarkers in diseases.In conclusion, Ac4GalNAz is a versatile compound with unique properties that make it useful in various scientific experiments. This compound has potential applications in diverse fields of research and industry, ranging from drug discovery to disease diagnosis. However, more research is needed to fully exploit its potential and overcome its limitations.CAS Number94427-00-6Product Name2,3,4,6-Tetra-O-acetyl-a-D-galactopyranosyl azideIUPAC Name[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-azidooxan-2-yl]methyl acetateMolecular FormulaC14H19N3O9Molecular Weight373.32 g/molInChIInChI=1S/C14H19N3O9/c1-6(18)22-5-10-11(23-7(2)19)12(24-8(3)20)13(25-9(4)21)14(26-10)16-17-15/h10-14H,5H2,1-4H3/t10-,11+,12+,13-,14+/m1/s1InChI KeyNHNYHKRWHCWHAJ-HTOAHKCRSA-NSMILESCC(=O)OCC1C(C(C(C(O1)N=[N+]=[N-])OC(=O)C)OC(=O)C)OC(=O)CCanonical SMILESCC(=O)OCC1C(C(C(C(O1)N=[N+]=[N-])OC(=O)C)OC(=O)C)OC(=O)CIsomeric SMILESCC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)N=[N+]=[N-])OC(=O)C)OC(=O)C)OC(=O)C
CAS No: 94427-00-6 MDL No: MFCD08703918 Chemical Formula: C14H19N3O9 Molecular Weight: 373.32