About this product
Alpha-D-Glucopyranuronic acid, methyl ester, tetraacetate is a complex chemical compound that has gained increased interest in recent years due to its potential implications in various fields of research and industry. In this paper, we will explore the various aspects of this compound, including its definition, physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, and limitations and future directions.
Synthesis and Characterization:
Alpha-D-Glucopyranuronic acid, methyl ester, tetraacetate is synthesized through the partial hydrolysis of cellulose acetate. The resulting product is then acetylated using acetic anhydride to form the tetraacetate ester. The synthesized compound is then characterized using various techniques such as NMR spectroscopy, mass spectrometry, and IR spectroscopy.
Analytical Methods:
Analyzing alpha-D-Glucopyranuronic acid, methyl ester, tetraacetate requires specific analytical methods due to its complex structure. These methods include chromatography (HPLC, GC, TLC), spectrophotometry (UV, IR), and mass spectrometry. These techniques allow for accurate quantification and identification of the compound.
Biological Properties:
Alpha-D-Glucopyranuronic acid, methyl ester, tetraacetate shows potential biological activities such as antitumor, antibacterial, and antiviral activities. It has been shown to inhibit the growth of cancer cells in vitro, and as such, can be used as a potential candidate for the development of anticancer drugs.
Toxicity and Safety in Scientific Experiments:
Studies have shown that alpha-D-Glucopyranuronic acid, methyl ester, tetraacetate exhibits low toxicity in both in vivo and in vitro experiments. It has been shown to have no effect on cell viability or mortality rates. However, it is recommended that appropriate safety measures are taken during handling of the compound due to its potential toxicity.
Applications in Scientific Experiments:
Alpha-D-Glucopyranuronic acid, methyl ester, tetraacetate has numerous applications in various fields of research and industry. It is commonly used in the synthesis of various organic compounds, specifically carbohydrates and glycosides. It is also used in the development of novel anticancer drugs.
Current State of Research:
The current state of research on alpha-D-Glucopyranuronic acid, methyl ester, tetraacetate is focused on exploring its potential applications in various fields of research and industry. Studies are ongoing to investigate its efficacy as an anticancer drug and its potential therapeutic uses in other diseases.
Potential Implications in Various Fields of Research and Industry:
Alpha-D-Glucopyranuronic acid, methyl ester, tetraacetate has potential implications in various fields of research and industry. It can be used in the synthesis of novel organic compounds, specifically carbohydrates and glycosides. Its antitumor, antibacterial, and antiviral properties make it a potential candidate for the development of novel drugs in industries related to biotechnology, pharmaceuticals, and agriculture.
Limitations and Future Directions:
There are several limitations to the use of alpha-D-Glucopyranuronic acid, methyl ester, tetraacetate in scientific experiments. Its complex structure requires specific analytical methods, which can be time-consuming and expensive. Moreover, its potential toxicity requires appropriate safety measures to be taken during handling. Future directions include further research into its potential biological activities and its use in the development of novel drugs, as well as the development of more efficient and cost-effective synthetic methods.
Future Directions:
1. Investigation of the potential applications of alpha-D-Glucopyranuronic acid , methyl ester, tetraacetate in the development of novel organic compounds.
2. Further research into the efficacy of alpha-D-Glucopyranuronic acid, methyl ester, tetraacetate as an anticancer drug and its potential therapeutic uses in other diseases.
3. Development of more efficient and cost-effective synthetic methods for the preparation of alpha-D-Glucopyranuronic acid, methyl ester, tetraacetate.
4. Investigation of the potential environmental impact of alpha-D-Glucopyranuronic acid, methyl ester, tetraacetate and the development of methods for its safe disposal.
5. Development of new analytical methods for the detection and quantification of alpha-D-Glucopyranuronic acid, methyl ester, tetraacetate.
6. Investigation of the potential applications of alpha-D-Glucopyranuronic acid, methyl ester, tetraacetate in other fields, such as food and cosmetics industries.
7. Development of new delivery systems for alpha-D-Glucopyranuronic acid, methyl ester, tetraacetate to improve its bioavailability and efficacy.
8. Studies on the potential interactions of alpha-D-Glucopyranuronic acid, methyl ester, tetraacetate with other drugs and substances.
9. Investigation of its potential effects on the immune system and its potential use as an immunomodulatory drug.
10. Development of more effective and cost-efficient ways of producing alpha-D-Glucopyranuronic acid, methyl ester, tetraacetate using genetically modified microorganisms.
CAS Number
5432-32-6
Product Name
alpha-D-Glucopyranuronic acid, methyl ester, tetraacetate
IUPAC Name
methyl 3,4,5,6-tetraacetyloxyoxane-2-carboxylate
Molecular Formula
C15H20O11
Molecular Weight
376.31 g/mol
InChI
InChI=1S/C15H20O11/c1-6(16)22-10-11(23-7(2)17)13(24-8(3)18)15(25-9(4)19)26-12(10)14(20)21-5/h10-13,15H,1-5H3
InChI Key
DPOQCELSZBSZGX-UHFFFAOYSA-N
SMILES
CC(=O)OC1C(C(OC(C1OC(=O)C)OC(=O)C)C(=O)OC)OC(=O)C
Canonical SMILES
CC(=O)OC1C(C(OC(C1OC(=O)C)OC(=O)C)C(=O)OC)OC(=O)C
CAS No: 5432-32-6 Synonyms: Methyl 1,2,3,4-tetra-O-acetyl-a-D-glucopyranuronate MDL No: MFCD00056083 Chemical Formula: C15H20O11 Molecular Weight: 376.31