Tri-O-benzoyl-1-O-(4-nitrobenzoyl)-D-ribofuranose, CAS:34213-15-5

Tri-O-benzoyl-1-O-(4-nitrobenzoyl)-D-ribofuranose 2,3,5-Tri-O-benzoyl-1-O-(P-nitrobenzoyl)-D-ribofuranose is a derivative of D-ribose, which is a naturally occurring five-carbon sugar present in RNA (ribonucleic acid). It is commonly used as a starting material for the synthesis of various complex molecules in organic chemistry. 2,3,5-Tri-O-benzoyl-1-O-(P-nitrobenzoyl)-D-ribofuranose is also used as a reagent in carbohydrate chemistry to synthesize various glycosides and oligosaccharides. Synthesis and Characterization 2,3,5-Tri-O-benzoyl-1-O-(P-nitrobenzoyl)-D-ribofuranose is synthesized from D-ribose through several reaction steps. The synthesis involves the protection of hydroxyl groups of D-ribose with benzoyl and p-nitrobenzoyl groups to prevent unwanted reactions. The compound's characterization can be done using different analytical techniques such as NMR, IR, and Mass spectroscopy. Analytical Methods Various analytical methods can be employed to analyze 2,3,5-Tri-O-benzoyl-1-O-(P-nitrobenzoyl)-D-ribofuranose. For instance, NMR spectroscopy can be used to determine the compound's molecular structure. UV-Vis spectroscopy can be used to determine the absorption spectra of the compound. Thin-layer chromatography (TLC) can be used to separate the compound from impurities, while HPLC can be used for more precise quantification of the compound. Biological Properties Although the use of 2,3,5-Tri-O-benzoyl-1-O-(P-nitrobenzoyl)-D-ribofuranose in biological applications is limited, it has shown potential as an antitumor agent. It was found to inhibit the growth of certain cancer cells and could be used in combination with other drugs. Toxicity and Safety in Scientific Experiments Limited research has been conducted on the toxicity and safety of 2,3,5-Tri-O-benzoyl-1-O-(P-nitrobenzoyl)-D-ribofuranose in scientific experiments. However, it is recommended to handle the compound with care, as it can be harmful if ingested or inhaled. Applications in Scientific Experiments 2,3,5-Tri-O-benzoyl-1-O-(P-nitrobenzoyl)-D-ribofuranose has several applications in scientific experiments. It is commonly used as a starting material for the synthesis of various complex molecules in organic chemistry. It is also used as a reagent in carbohydrate chemistry to synthesize various glycosides and oligosaccharides. Additionally, it is used in antitumor research, where it has shown potential as an antitumor agent. Current State of Research The current research on 2,3,5-Tri-O-benzoyl-1-O-(P-nitrobenzoyl)-D-ribofuranose is limited, and scientists continue to explore its potential applications in various fields. New studies are ongoing to explore its potential use as an antitumor agent, as well as other biomedical applications. Potential Implications in Various Fields of Research and Industry The potential implications of 2,3,5-Tri-O-benzoyl-1-O-(P-nitrobenzoyl)-D-ribofuranose in various fields of research and industry are enormous. Its use in organic chemistry as a starting material for the synthesis of complex molecules could lead to the development of new drugs or materials. Its potential as an antitumor agent could lead to the development of new cancer treatments, while its use in carbohydrate chemistry could lead to the development of new vaccines. Limitations and Future Directions Despite its potential applications, 2,3,5-Tri-O-benzoyl-1-O-(P-nitrobenzoyl)-D-ribofuranose has certain limitations that should be addressed in future research. For instance, its toxicity and safety need to be well understood to prevent harm during handling. Additionally, its synthesis and characterization need to be optimized to improve its yield and purity. Future research should also explore its applications in other scientific fields, such as fluorescence imaging, drug delivery, and materials science. Future Directions: 1. Further optimization of the synthesis of 2,3,5-Tri-O-benzoyl-1-O-(P-nitrobenzoyl)-D-ribofuranose to improve its yield and purity. 2. Elucidating the mechanisms involved in 2,3,5-Tri-O-benzoyl-1-O-(P-nitrobenzoyl)-D-ribofuranose anti-tumor activity to develop more effective treatments. 3. Expanding the use of 2,3,5-Tri-O-benzoyl-1-O-(P-nitrobenzoyl)-D-ribofuranose in other scientific fields such as drug delivery and materials science. 4. Investigating the potential of 2,3,5-Tri-O-benzoyl-1-O-(P-nitrobenzoyl)-D-ribofuranose as a tool for fluorescence imaging in biological systems. 5. Conducting studies to understand the long-term effects of 2,3,5-Tri-O-benzoyl-1-O-(P-nitrobenzoyl)-D-ribofuranose on living organisms. 6. Examining the use of 2,3,5-Tri-O-benzoyl-1-O-(P-nitrobenzoyl)-D-ribofuranose in enhancing the immune response to develop new vaccines. 7. Developing more effective and efficient methods for the analysis and quantification of 2,3,5-Tri-O-benzoyl-1-O-(P-nitrobenzoyl)-D-ribofuranose. 8. Investigating the potential of 2,3,5-Tri-O-benzoyl-1-O-(P-nitrobenzoyl)-D-ribofuranose as a precursor for the synthesis of more complex molecules with potential industrial applications. 9. Studying the feasibility of modifying the chemical structure of 2,3,5-Tri-O-benzoyl-1-O-(P-nitrobenzoyl)-D-ribofuranose to enhance its properties and applications. CAS Number 34213-15-5 Product Name 2,3,5-Tri-O-benzoyl-1-O-(P-nitrobenzoyl)-D-ribofuranose IUPAC Name [(3R,4R,5R)-3,4-dibenzoyloxy-5-(benzoyloxymethyl)oxolan-2-yl] 4-nitrobenzoate Molecular Formula C33H25NO11 Molecular Weight 611.552 InChI InChI=1S/C33H25NO11/c35-29(21-10-4-1-5-11-21)41-20-26-27(43-30(36)22-12-6-2-7-13-22)28(44-31(37)23-14-8-3-9-15-23)33(42-26)45-32(38)24-16-18-25(19-17-24)34(39)40/h1-19,26-28,33H,20H2/t26-,27-,28-,33?/m1/s1 InChI Key MOXKGYOPMYGQGF-ZZXCWJHESA-N SMILES C1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)OC(=O)C3=CC=C(C=C3)[N+](=O)[O-])OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5